Detailed information for compound 103517
Basic information
Technical information
- TDR Targets ID: 103517
- Name: 2-[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-tri hydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-d ioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4- yl]amino]acetonitrile
- MW: 582.555 | Formula: C29H30N2O11
-
H donors: 6
H acceptors: 9
LogP: 1.52
Rotable bonds: 7
Rule of 5 violations (Lipinski): 3 - SMILES: N#CCNC1CC(OC(C1O)C)O[C@H]1C[C@@](O)(Cc2c1c(O)c1c(c2O)C(=O)c2c(C1=O)c(OC)ccc2)C(=O)CO
- InChi: 1S/C29H30N2O11/c1-12-24(34)15(31-7-6-30)8-19(41-12)42-17-10-29(39,18(33)11-32)9-14-21(17)28(38)23-22(26(14)36)25(35)13-4-3-5-16(40-2)20(13)27(23)37/h3-5,12,15,17,19,24,31-32,34,36,38-39H,7-11H2,1-2H3/t12?,15?,17-,19?,24?,29-/m0/s1
- InChiKey: SDWZXVTWORCAMD-MVGXARHUSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]tetrahydropyran-4-yl]amino]acetonitrile
- 2-[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxy-1-oxoethyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-4-tetrahydropyranyl]amino]acetonitrile
- 2-[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyethanoyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino]ethanenitrile
- 2-[[6-[[(1S,3S)-3-glycoloyl-3,5,12-trihydroxy-6,11-diketo-10-methoxy-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyl-tetrahydropyran-4-yl]amino]acetonitrile
- 5,12-Naphthacenedione, 10-[[3-[(cyanomethyl)amino]-2,3,6-trideoxy-.alpha.-L-lyxo-hexopyranosyl]oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, (8S-cis)-
- NSC381425
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trichomonas vaginalis | conserved hypothetical protein | 0.007 | 0.5558 | 0.0406 |
| Entamoeba histolytica | hypothetical protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus granulosus | replication factor c subunit 1 | 0.011 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.011 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | NAD-dependent DNA ligase, Lig | 0.011 | 1 | 1 |
| Trichomonas vaginalis | replication factor C large subunit, putative | 0.011 | 1 | 1 |
| Trypanosoma brucei | BRCA1 C Terminus (BRCT) domain containing protein, putative | 0.011 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase | 0.0069 | 0.537 | 0.537 |
| Schistosoma mansoni | alpha-amylase | 0.0074 | 0.5963 | 0.0911 |
| Trypanosoma cruzi | BRCA1 C Terminus (BRCT) domain containing protein, putative | 0.011 | 1 | 1 |
| Echinococcus granulosus | nibrin | 0.011 | 1 | 1 |
| Schistosoma mansoni | DNA ligase IV | 0.011 | 1 | 1 |
| Brugia malayi | ATP dependent DNA ligase C terminal region family protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | alpha glucosidase | 0.0074 | 0.5963 | 0.0911 |
| Mycobacterium ulcerans | NAD-dependent DNA ligase LigA | 0.011 | 1 | 1 |
| Entamoeba histolytica | Activator 1 140 kDa subunit, putative | 0.011 | 1 | 1 |
| Treponema pallidum | DNA ligase (lig) | 0.011 | 1 | 0.5 |
| Brugia malayi | topoisomerase | 0.011 | 1 | 1 |
| Toxoplasma gondii | ATPase, AAA family protein | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Echinococcus multilocularis | nibrin | 0.011 | 1 | 1 |
| Schistosoma mansoni | alpha-amylase | 0.0074 | 0.5963 | 0.0911 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.011 | 1 | 1 |
| Trypanosoma brucei | peptidyl-prolyl cis-trans isomerase/rotamase, putative | 0.0069 | 0.537 | 0.537 |
| Mycobacterium leprae | PROBABLE DNA LIGASE [NAD DEPENDENT] LIGA (POLYDEOXYRIBONUCLEOTIDE SYNTHASE [NAD+]) | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | alpha amylase | 0.0074 | 0.5963 | 0.0911 |
| Toxoplasma gondii | peptidylprolyl isomerase | 0.0069 | 0.537 | 0.537 |
| Entamoeba histolytica | oligo-1,6-glucosidase, putative | 0.0074 | 0.5963 | 0.128 |
| Trichomonas vaginalis | RNA polymerase II ctd phosphatase, putative | 0.011 | 1 | 1 |
| Mycobacterium tuberculosis | Probable alpha-glucosidase AglA (maltase) (glucoinvertase) (glucosidosucrase) (maltase-glucoamylase) (lysosomal alpha-glucosidas | 0.0074 | 0.5963 | 0.5 |
| Toxoplasma gondii | poly(ADP-ribose) polymerase catalytic domain-containing protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | rotamase, putative | 0.007 | 0.5558 | 0.0406 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Brugia malayi | DKFZp564C0469 protein | 0.011 | 1 | 1 |
| Brugia malayi | Alpha amylase, catalytic domain containing protein | 0.0074 | 0.5963 | 0.0911 |
| Giardia lamblia | Replication factor C, subunit 1 | 0.011 | 1 | 0.5 |
| Schistosoma mansoni | alpha-amylase | 0.0074 | 0.5963 | 0.0911 |
| Onchocerca volvulus | 0.011 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | RNA polymerase II ctd phosphatase, putative | 0.011 | 1 | 1 |
| Schistosoma mansoni | topbp1 | 0.011 | 1 | 1 |
| Mycobacterium tuberculosis | Trehalose synthase TreS | 0.0074 | 0.5963 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.011 | 1 | 1 |
| Plasmodium falciparum | replication factor C subunit 1, putative | 0.011 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 1 | 1 |
| Schistosoma mansoni | chromosome transmission fidelity factor | 0.011 | 1 | 1 |
| Schistosoma mansoni | alpha-amylase | 0.0074 | 0.5963 | 0.0911 |
| Plasmodium vivax | replication factor C subunit 1, putative | 0.011 | 1 | 0.5 |
| Brugia malayi | Pax transcription activation domain interacting protein | 0.011 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.011 | 1 | 1 |
| Chlamydia trachomatis | DNA ligase | 0.011 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.011 | 1 | 1 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase | 0.0069 | 0.537 | 0.537 |
| Echinococcus multilocularis | replication factor c subunit 1 | 0.011 | 1 | 1 |
| Trichomonas vaginalis | chromosome transmission fidelity factor, putative | 0.011 | 1 | 1 |
| Trypanosoma cruzi | FHA domain containing protein, putative | 0.011 | 1 | 1 |
| Brugia malayi | Alpha amylase, catalytic domain containing protein | 0.0074 | 0.5963 | 0.0911 |
| Trichomonas vaginalis | chromosome transmission fidelity factor, putative | 0.011 | 1 | 1 |
| Leishmania major | peptidyl-prolyl cis-trans isomerase/rotamase, putative,PPIase, putative | 0.0069 | 0.537 | 1 |
| Schistosoma mansoni | alpha-amylase | 0.0074 | 0.5963 | 0.0911 |
| Echinococcus granulosus | alpha glucosidase | 0.0074 | 0.5963 | 0.0911 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.011 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.011 | 1 | 1 |
| Schistosoma mansoni | topbp1 | 0.011 | 1 | 1 |
| Loa Loa (eye worm) | alpha amylase | 0.0074 | 0.5963 | 0.0911 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Change in Tm (ADMET) | = 13.9 | Compound was evaluated for the change in Tm of isolated helical DNA in solution. | ChEMBL. | 3761325 |
| ED50 (functional) | = 0.29 uM | Compound was evaluated for the 50% inhibition of the incorporation of [3H]- thymidine in the RNA (inhibition of synthesis in leukemia L1210 cells) | ChEMBL. | 3761325 |
| ED50 (functional) | = 0.29 uM | Compound was evaluated for the 50% inhibition of the incorporation of [3H]- thymidine in the RNA (inhibition of synthesis in leukemia L1210 cells) | ChEMBL. | 3761325 |
| ED50 (functional) | = 1.2 uM | Compound was evaluated for the 50% inhibition of the incorporation of [3H]- thymidine in the DNA (inhibition of synthesis in leukemia L1210 cells) | ChEMBL. | 3761325 |
| ED50 (functional) | = 1.2 uM | Compound was evaluated for the 50% inhibition of the incorporation of [3H]- thymidine in the DNA (inhibition of synthesis in leukemia L1210 cells) | ChEMBL. | 3761325 |
| IC50 (functional) | = 0.028 uM | Compound was evaluated for the growth inhibition of P388/s cells. | ChEMBL. | 3761325 |
| IC50 (functional) | = 0.028 uM | Compound was evaluated for the growth inhibition of P388/s cells. | ChEMBL. | 3761325 |
| IC50 (functional) | = 0.4 uM | Compound was evaluated for the growth inhibition of P388/ADR cells. | ChEMBL. | 3761325 |
| IC50 (functional) | = 0.4 uM | Compound was evaluated for the growth inhibition of P388/ADR cells. | ChEMBL. | 3761325 |
| logD | = 1.2 | Partition coefficient of the compound in octanol-phosphate buffer at pH 7.4 | ChEMBL. | 3761325 |
| Ratio (functional) | = 14 | Resistance index measured as ratio of IC50 value of P388/ ADR to that of P388/ S | ChEMBL. | 3761325 |
| Recovery (ADMET) | = 82 % | Percent recovery of compound at pH 7 | ChEMBL. | 3761325 |
| Recovery (ADMET) | = 86 % | Percent recovery of compound at pH 4 | ChEMBL. | 3761325 |
| Recovery (ADMET) | = 92 % | Percent recovery of compound at pH 2 | ChEMBL. | 3761325 |
| T/C (functional) | = 148 % | Compound was evaluated for the antitumor efficacy at optimal dose 8.0 mg/kg against leukemia P388 in mice on day q4d 5, 9, 13., | ChEMBL. | 3761325 |
| T/C (functional) | = 148 % | Compound was evaluated for the antitumor efficacy at optimal dose 8.0 mg/kg against leukemia P388 in mice on day q4d 5, 9, 13., | ChEMBL. | 3761325 |
| T/C (functional) | = 184 % | Compound was evaluated for the antitumor efficacy at optimal dose 3.1 mg/kg against leukemia P388 in mice on day 1, | ChEMBL. | 3761325 |
| T/C (functional) | = 184 % | Compound was evaluated for the antitumor efficacy at optimal dose 3.1 mg/kg against leukemia P388 in mice on day 1, | ChEMBL. | 3761325 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Mus musculus | ChEMBL23 | 3761325 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 24200565
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.