Detailed information for compound 104572
Basic information
Technical information
- Name: Unnamed compound
- MW: 322.404 | Formula: C19H22N4O
-
H donors: 2
H acceptors: 1
LogP: 2.65
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(c1nc2cccc3c2c([nH]1)ccc3)NCCN1CCCCC1
- InChi: 1S/C19H22N4O/c24-19(20-10-13-23-11-2-1-3-12-23)18-21-15-8-4-6-14-7-5-9-16(22-18)17(14)15/h4-9H,1-3,10-13H2,(H,20,24)(H,21,22)
- InChiKey: MLGCDAKEDYZYMT-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0013 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Leishmania major | oxidoreductase-like protein | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0013 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0013 | 1 | 1 |
| Leishmania major | pteridine reductase 1 | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | dehydrogenase | 0.0013 | 1 | 1 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0013 | 1 | 0.5 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0013 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0013 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0013 | 1 | 0.5 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0013 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0013 | 1 | 1 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0013 | 1 | 1 |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0013 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0013 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | oxidoreductase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0013 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0013 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0013 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0013 | 1 | 0.5 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0013 | 1 | 0.5 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Leishmania major | short chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0013 | 1 | 1 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0013 | 1 | 0.5 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0013 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0013 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0013 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0013 | 1 | 1 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Giardia lamblia | Reductase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0013 | 1 | 1 |
| Leishmania major | short chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Echinococcus granulosus | oxidoreductase | 0.0013 | 1 | 1 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0013 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0013 | 1 | 1 |
| Echinococcus multilocularis | oxidoreductase | 0.0013 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0013 | 1 | 0.5 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0013 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0013 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0013 | 1 | 0.5 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Leishmania major | dehydrogenase-like protein | 0.0013 | 1 | 0.5 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0013 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0013 | 1 | 1 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0013 | 1 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0013 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0013 | 1 | 0.5 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0013 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0013 | 1 | 1 |
| Onchocerca volvulus | 0.0013 | 1 | 1 | |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0013 | 1 | 1 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0013 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0013 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0013 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0013 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0013 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0013 | 1 | 0.5 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0013 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0013 | 1 | 0.5 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0013 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0013 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0013 | 1 | 0.5 |
| Giardia lamblia | Hypothetical protein | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0013 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0013 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0013 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0013 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 1.3 uM | In vitro growth inhibition of murine leukemia L1210 cells after 40 hours exposure. | ChEMBL. | 3669016 |
| IC50 (functional) | = 1.3 uM | In vitro growth inhibition of murine leukemia L1210 cells after 40 hours exposure. | ChEMBL. | 3669016 |
| ILS (functional) | 0 % | Percent increase in life span of drug treated tumor( P388 leukemia cells)-bearing animal compared to that of untreated tumor bearing control when treated at optimal dose ; ND means no data | ChEMBL. | 3669016 |
| Log K (binding) | 0 | DNA binding constant to poly[d(A-T)] determined by ethidium bromide displacement (from E. coli plasmid pNZ116 ); ND means no data | ChEMBL. | 3669016 |
| Log K (binding) | 0 | DNA binding constant to poly[d(G-C)] determined by ethidium bromide displacement from E. coli plasmid pNZ116; ND means no data | ChEMBL. | 3669016 |
| OD (functional) | 0 mg kg-1 day-1 | Optimal dose of the compound administered intraperitoneally as a solution in 0.1 mL of 30% v/v ethanol-water on days 1,5 and 9 after intraperitoneal inoculation of 10 e6 P388 leukemia cells ; ND means no data | ChEMBL. | 3669016 |
| pKa | 0 | The pKa value of the compound was determined spectrophotometrically in water at 25 degree centigrade ; ND means no data | ChEMBL. | 3669016 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Mus musculus | ChEMBL23 | 3669016 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.