Detailed information for compound 106285
Basic information
Technical information
- TDR Targets ID: 106285
- Name: N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)- 2-[6-[(3-methoxynaphthalen-1-yl)methylamino]p urin-9-yl]oxolan-3-yl]-3-methoxybenzamide
- MW: 570.596 | Formula: C30H30N6O6
-
H donors: 4
H acceptors: 6
LogP: 3.1
Rotable bonds: 10
Rule of 5 violations (Lipinski): 2 - SMILES: COc1cccc(c1)C(=O)N[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2NCc1cc(OC)cc2c1cccc2)CO
- InChi: 1S/C30H30N6O6/c1-40-20-8-5-7-18(11-20)29(39)35-24-26(38)23(14-37)42-30(24)36-16-34-25-27(32-15-33-28(25)36)31-13-19-12-21(41-2)10-17-6-3-4-9-22(17)19/h3-12,15-16,23-24,26,30,37-38H,13-14H2,1-2H3,(H,35,39)(H,31,32,33)/t23-,24-,26-,30-/m1/s1
- InChiKey: ZBOPYJAIRJVQBA-JVUUKAHWSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-methoxy-1-naphthyl)methylamino]purin-9-yl]tetrahydrofuran-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-methoxy-1-naphthyl)methylamino]-9-purinyl]-3-tetrahydrofuranyl]-3-methoxybenzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-methoxynaphthalen-1-yl)methylamino]purin-9-yl]oxolan-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-2-[6-[(3-methoxy-1-naphthyl)methylamino]purin-9-yl]-5-methylol-tetrahydrofuran-3-yl]-3-methoxy-benzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | glyceraldehyde-3-phosphate dehydrogenase | Starlite/ChEMBL | References |
| Leishmania mexicana | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 331 aa | 331 aa | 27.8 % |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde-3-phosphate dehydrogenase | 293 aa | 259 aa | 28.2 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | cysteine proteinase cathepsin Z | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | serine repeat antigen 7 | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | vivapain-3 | 0.0489 | 0.4975 | 0.4681 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.0353 | 0.3424 | 0.5 |
| Brugia malayi | cathepsin L precursor | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 9 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | unspecified product | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Encystation-specific protease | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Toxoplasma gondii | cathepsin CPC2 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.03 | 0.2813 | 0.2813 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin F-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | Eukaryotic initiation factor 4A homolog | 0.0102 | 0.0554 | 0.0554 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Loa Loa (eye worm) | calcium binding EGF domain-containing protein | 0.0105 | 0.0592 | 0.0592 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Plasmodium falciparum | serine repeat antigen 5 | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Onchocerca volvulus | 0.0628 | 0.6574 | 0.6574 | |
| Echinococcus granulosus | cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0102 | 0.0554 | 0.0554 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Plasmodium vivax | dipeptidyl aminopeptidase 1, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.03 | 0.2813 | 0.2391 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Schistosoma mansoni | subfamily C1A non-peptidase homologue (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Plasmodium vivax | vivapain-1 | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin L-like cysteine proteinase, identical | 0.03 | 0.2813 | 0.2813 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0408 | 0.4049 | 0.37 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Toxoplasma gondii | cathepsin CPL | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0141 | 0.1002 | 0.1002 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Loa Loa (eye worm) | fibroinase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0105 | 0.0592 | 0.0592 | |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.0353 | 0.3424 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Toxoplasma gondii | cathepsin B | 0.0408 | 0.4049 | 0.37 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Schistosoma mansoni | dipeptidyl-peptidase I (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.03 | 0.2813 | 0.2813 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin S (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 1 | 0.0189 | 0.155 | 0.1054 |
| Mycobacterium tuberculosis | Probable cold-shock DeaD-box protein A homolog DeaD (ATP-dependent RNA helicase dead homolog) | 0.0102 | 0.0554 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Schistosoma mansoni | cathepsin s | 0.03 | 0.2813 | 0.2391 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0928 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.8211 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | unspecified product | 0.03 | 0.2813 | 0.2391 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Brugia malayi | glyceraldehyde 3-phosphate dehydrogenase | 0.0127 | 0.0838 | 0.0838 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | ctsf protein | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L, S or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 2 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0141 | 0.1002 | 0.0474 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Calcium binding EGF domain containing protein | 0.0105 | 0.0592 | 0.0592 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | dipeptidyl aminopeptidase 2, putative | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.03 | 0.2813 | 0.2813 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | unspecified product | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0408 | 0.4049 | 0.37 |
| Giardia lamblia | Cathepsin B-like cysteine proteinase 3 precursor | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0408 | 0.4049 | 0.37 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | serine repeat antigen 4 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0408 | 0.4049 | 0.37 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0628 | 0.6574 | 0.6373 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0896 | 0.9633 | 0.9633 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0189 | 0.155 | 0.155 | |
| Plasmodium vivax | serine-repeat antigen 2 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0268 | 0.2454 | 0.5434 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 6 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Brugia malayi | fibroinase precursor | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0628 | 0.6574 | 0.6373 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0896 | 0.9633 | 0.9633 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 3 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3424 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Leishmania major | glyceraldehyde-3-phosphate dehydrogenase-like protein | 0.0844 | 0.9039 | 0.8983 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin l1 | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Entamoeba histolytica | cysteine proteinase 1, putative | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.03 | 0.2813 | 0.2391 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0212 | 0.1809 | 0.1809 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0628 | 0.6574 | 0.6574 |
| Echinococcus granulosus | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase 2 | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Loa Loa (eye worm) | cathepsin B | 0.0408 | 0.4049 | 0.4049 |
| Brugia malayi | cathepsin L-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | serine repeat antigen 2 | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0896 | 0.9633 | 0.9611 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin C | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0628 | 0.6574 | 0.6373 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0408 | 0.4049 | 0.37 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | serine-repeat antigen 5 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0083 | 0.0334 | 0.0334 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0127 | 0.0838 | 0.0301 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | dipeptidyl aminopeptidase 3, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 3 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Toxoplasma gondii | cathepsin CPC1 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin B (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Loa Loa (eye worm) | hypothetical protein | 0.0057 | 0.0034 | 0.0034 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | serine repeat antigen 8 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Plasmodium vivax | serine-repeat antigen 3 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | cysteine protease | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin l1 | 0.0628 | 0.6574 | 0.6373 |
| Loa Loa (eye worm) | hypothetical protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.0353 | 0.3424 | 0.5 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0085 | 0.0358 | 0.5 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Brugia malayi | eukaryotic initiation factor 4A | 0.0102 | 0.0554 | 0.0554 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Toxoplasma gondii | preprocathepsin c precursor, putative | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Brugia malayi | cahepsin L-like non-peptiedase homolog | 0.0189 | 0.155 | 0.155 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Entamoeba histolytica | cysteine protease, putative | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 20 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | = 20 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | = 31 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | = 31 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| IC50 (binding) | = 3 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 3 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL63569
- PubChem: 11731457
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.