Detailed information for compound 1365776
Basic information
Technical information
- TDR Targets ID: 1365776
- Name: 2-methyl-N-[2,2,2-trichloro-1-[[2-chloro-5-(t rifluoromethyl)phenyl]amino]ethyl]propanamide
- MW: 412.062 | Formula: C13H13Cl4F3N2O
-
H donors: 2
H acceptors: 1
LogP: 6.34
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(C(C)C)NC(C(Cl)(Cl)Cl)Nc1cc(ccc1Cl)C(F)(F)F
- InChi: 1S/C13H13Cl4F3N2O/c1-6(2)10(23)22-11(12(15,16)17)21-9-5-7(13(18,19)20)3-4-8(9)14/h3-6,11,21H,1-2H3,(H,22,23)
- InChiKey: OTRXTFIVXJNQHL-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-methyl-N-[2,2,2-trichloro-1-[[2-chloro-5-(trifluoromethyl)phenyl]amino]ethyl]propionamide
- ST5336522
- BAS 00136903
- MLS000561731
- N-[2,2,2-Trichloro-1-(2-chloro-5-trifluoromethyl-phenylamino)-ethyl]-isobutyramide
- SMR000173948
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | ataxin 2 | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | lamin A/C | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Loa Loa (eye worm) | pigment dispersing factor receptor c | glucagon-like peptide 1 receptor | 463 aa | 388 aa | 25.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0019 | 0.0319 | 0.0319 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0319 | 0.0319 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | intermediate filament protein | 0.0033 | 0.3012 | 0.3012 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0033 | 0.3012 | 0.3012 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | lamin dm0 | 0.0033 | 0.3012 | 0.2782 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | lamin | 0.0033 | 0.3012 | 0.2782 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Loa Loa (eye worm) | intermediate filament protein | 0.0033 | 0.3012 | 0.3012 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Echinococcus multilocularis | lamin dm0 | 0.0033 | 0.3012 | 0.2782 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | lamin | 0.0033 | 0.3012 | 0.2782 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.8517 | 0.8517 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0033 | 0.3012 | 0.3012 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0019 | 0.0319 | 0.0319 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.4723 | 0.4549 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | oxidoreductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.003 | 0.2588 | 0.2588 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Giardia lamblia | Reductase, putative | 0.0068 | 1 | 0.5 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.4723 | 0.4723 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.8517 | 0.8517 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | lamin | 0.0033 | 0.3012 | 0.2782 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Leishmania major | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.8517 | 0.8517 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Giardia lamblia | Hypothetical protein | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.2588 | 0.2588 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Leishmania major | pteridine reductase 1 | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Echinococcus multilocularis | musashi | 0.0033 | 0.3012 | 0.2782 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.4723 | 0.4723 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Leishmania major | dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | intermediate filament protein | 0.0033 | 0.3012 | 0.2782 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.2893 | 0.2893 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.8517 | 0.8517 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | intermediate filament proteins | 0.0033 | 0.3012 | 0.2782 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 1 | |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | lamin | 0.0033 | 0.3012 | 0.2782 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.002 | 0.0439 | 0.0439 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0019 | 0.0319 | 0.0319 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.3012 | 0.3012 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 3.6626 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (functional) | 6.3096 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 13.1154 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 14.7157 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PubChem BioAssay. qHTS for Antagonists of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | ||
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1495726
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.