Detailed information for compound 1632505
Basic information
Technical information
- TDR Targets ID: 1632505
- Name: 4-methyl-N-(pyridin-4-ylmethylideneamino)anil ine hydrochloride
- MW: 247.723 | Formula: C13H14ClN3
-
H donors: 1
H acceptors: 1
LogP: 3.63
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1ccc(cc1)N/N=C/c1ccncc1.Cl
- InChi: 1S/C13H13N3.ClH/c1-11-2-4-13(5-3-11)16-15-10-12-6-8-14-9-7-12;/h2-10,16H,1H3;1H/b15-10+;
- InChiKey: RIYVMGZHYPRMJQ-GYVLLFFHSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 4-methyl-N-(4-pyridylmethyleneamino)aniline hydrochloride
- p-tolyl-(4-pyridylmethyleneamino)amine hydrochloride
- T0506-7253
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | Niemann-Pick disease, type C1 | Starlite/ChEMBL | No references |
| Homo sapiens | glucosidase, alpha | Starlite/ChEMBL | No references |
| Homo sapiens | ATPase family, AAA domain containing 5 | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Photinus pyralis | Luciferin 4-monooxygenase | Starlite/ChEMBL | No references |
| Homo sapiens | tumor protein p53 | Starlite/ChEMBL | No references |
| Homo sapiens | breast cancer 1, early onset | Starlite/ChEMBL | No references |
| Homo sapiens | RAB9A, member RAS oncogene family | Starlite/ChEMBL | No references |
| Influenza A virus | Nonstructural protein 1 | Starlite/ChEMBL | No references |
| Homo sapiens | heat shock 70kDa protein 5 (glucose-regulated protein, 78kDa) | Starlite/ChEMBL | No references |
| Homo sapiens | isocitrate dehydrogenase 1 (NADP+), soluble | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | neutral alpha glucosidase AB | 0.0044 | 0.0217 | 0.0217 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | Zn-finger in Ran binding protein and others containing protein | 0.041 | 0.3449 | 0.3449 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Echinococcus granulosus | E3 ubiquitin protein ligase Bre1 | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus granulosus | cell growth regulator with ring finger domain | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Plasmodium falciparum | trophozoite exported protein 1 | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | hypothetical protein | 0.1154 | 1 | 1 |
| Trypanosoma brucei | SNF2 family N-terminal domain/Ring finger domain containing protein, putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0195 | 0.0195 |
| Toxoplasma gondii | helicase, putative | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | TRABID protein (C64 family) | 0.041 | 0.3449 | 0.3449 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.1154 | 1 | 1 |
| Schistosoma mansoni | brg-1 associated factor | 0.1154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.002 | 0.002 |
| Brugia malayi | Neuralized family protein | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus granulosus | E3 ubiquitin protein ligase LRSAM1 | 0.0021 | 0.0016 | 0.0016 |
| Brugia malayi | brahma associated protein 60 kDa | 0.1154 | 1 | 1 |
| Chlamydia trachomatis | SWIB complex protein | 0.1154 | 1 | 1 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.017 | 0.1329 | 0.1329 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.1154 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.1566 | 0.1566 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | peter pan-related | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0084 | 0.0084 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger)/EF-hand domain pair, putative | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus multilocularis | atpase aaa+ type core atpase aaa type core | 0.0979 | 0.8463 | 0.8463 |
| Plasmodium vivax | RING zinc finger protein, putative | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | WLM domain containing protein, putative | 0.041 | 0.3449 | 1 |
| Echinococcus multilocularis | E3 ubiquitin protein ligase LRSAM1 | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Kinase, NEK | 0.0021 | 0.0016 | 0.5 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0217 | 0.0201 |
| Onchocerca volvulus | 0.041 | 0.3449 | 0.3438 | |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.1325 | 0.1325 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.002 | 0.002 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.0119 | 0.088 | 0.088 |
| Trypanosoma cruzi | hypothetical protein | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Toxoplasma gondii | zinc finger, C3HC4 type (RING finger) domain-containing protein | 0.0021 | 0.0016 | 0.0016 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0217 | 0.0201 |
| Trypanosoma cruzi | Zn-finger in Ran binding protein and others, putative | 0.041 | 0.3449 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | zinc finger protein | 0.041 | 0.3449 | 0.3449 |
| Echinococcus multilocularis | ring finger protein 170 | 0.0021 | 0.0016 | 0.0016 |
| Leishmania major | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Brugia malayi | Zinc finger protein 183 homolog | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Echinococcus multilocularis | E3 ubiquitin protein ligase Bre1 | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Trypanosoma cruzi | Zn-finger in Ran binding protein and others, putative | 0.041 | 0.3449 | 1 |
| Leishmania major | hypothetical protein, unknown function | 0.0021 | 0.0016 | 0.0046 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0029 | 0.0084 | 1 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | fusion | 0.041 | 0.3449 | 0.3449 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.0362 | 0.0362 |
| Echinococcus granulosus | ring finger protein 170 | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus multilocularis | Upstream activation factor subunit UAF30 | 0.1154 | 1 | 1 |
| Giardia lamblia | Kinase | 0.0021 | 0.0016 | 0.5 |
| Giardia lamblia | Ribonuclease | 0.0021 | 0.0016 | 0.5 |
| Brugia malayi | RING finger protein 20 | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | cellular tumor antigen P53 | 0.006 | 0.0358 | 0.0358 |
| Trypanosoma cruzi | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.0195 | 0.0195 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.1566 | 0.1566 |
| Leishmania major | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus multilocularis | RING finger and transmembrane domain containing protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Plasmodium falciparum | zinc finger protein, putative | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | mitochondrial RNA binding complex 1 subunit | 0.041 | 0.3449 | 1 |
| Echinococcus multilocularis | sterol regulatory element binding protein | 0.0051 | 0.0282 | 0.0282 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Echinococcus multilocularis | ring and YY1 binding protein | 0.041 | 0.3449 | 0.3449 |
| Onchocerca volvulus | 0.041 | 0.3449 | 0.3438 | |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0084 | 0.0244 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.0362 | 0.0362 |
| Onchocerca volvulus | 0.006 | 0.0358 | 0.0343 | |
| Brugia malayi | Zinc finger, C2H2 type family protein | 0.0021 | 0.0016 | 0.0016 |
| Brugia malayi | B-box zinc finger family protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma brucei | DNA repair protein, putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | RING finger protein 20 | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Toxoplasma gondii | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Leishmania major | DNA repair protein-like protein | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.1154 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Entamoeba histolytica | Niemann-Pick C1 protein, putative | 0.0119 | 0.088 | 1 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Brugia malayi | YY1-associated factor 2 | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Ser/Thr protein kinase | 0.0021 | 0.0016 | 0.5 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.1325 | 0.1325 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0044 | 0.0217 | 0.0217 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0021 | 0.002 | 0.002 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Echinococcus multilocularis | protein patched | 0.0051 | 0.0282 | 0.0282 |
| Plasmodium vivax | zinc finger protein, putative | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | peter pan-related | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0217 | 0.0201 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Toxoplasma gondii | SWIB/MDM2 domain-containing protein | 0.1154 | 1 | 1 |
| Echinococcus granulosus | ring and YY1 binding protein | 0.041 | 0.3449 | 0.3449 |
| Onchocerca volvulus | Ubiquitin thioesterase ZRANB1 homolog | 0.041 | 0.3449 | 0.3438 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0044 | 0.0217 | 0.0201 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Onchocerca volvulus | 0.1154 | 1 | 1 | |
| Leishmania major | alpha glucosidase II subunit, putative | 0.0044 | 0.0217 | 0.0628 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0029 | 0.0084 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Giardia lamblia | E3 ubiquitin ligase for Rad6p required for the ubiquitination of histone H2B | 0.0021 | 0.0016 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0217 | 0.0201 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0084 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.0362 | 0.0362 |
| Trypanosoma brucei | predicted zinc finger protein | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus granulosus | E3 ubiquitin protein ligase RNF146 | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus granulosus | expressed conserved protein | 0.0112 | 0.0816 | 0.0816 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.0358 | 0.0358 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0084 | 0.0084 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.0195 | 0.0195 |
| Echinococcus granulosus | E3 ubiquitin protein ligase mib1 | 0.0021 | 0.0016 | 0.0016 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0084 | 0.0244 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0217 | 0.0201 |
| Plasmodium vivax | E3 ubiquitin-protein ligase RNF5, putative | 0.0021 | 0.0016 | 0.0016 |
| Leishmania major | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0084 | 0.0084 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 0.0282 | 0.0282 |
| Echinococcus granulosus | lysosomal alpha glucosidase | 0.0197 | 0.1566 | 0.1566 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.0119 | 0.088 | 0.088 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.0362 | 0.0362 |
| Toxoplasma gondii | zinc finger, C3HC4 type (RING finger) domain-containing protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus granulosus | zinc finger protein Ran binding | 0.041 | 0.3449 | 0.3449 |
| Echinococcus granulosus | Nuclear pore complex protein Nup153 | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger) containing protein, putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.0265 | 0.0265 |
| Plasmodium falciparum | E3 ubiquitin-protein ligase RNF5, putative | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.1154 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0084 | 1 |
| Echinococcus granulosus | E3 ubiquitin protein ligase MYLIP | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | ring finger protein 151 | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0044 | 0.0217 | 0.0217 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Toxoplasma gondii | SWI2/SNF2-containing protein RAD5 | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus multilocularis | E3 ubiquitin protein ligase MYLIP | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Zinc finger domain | 0.0021 | 0.0016 | 0.5 |
| Trichomonas vaginalis | sucrase-isomaltase, putative | 0.0044 | 0.0217 | 0.0201 |
| Echinococcus multilocularis | RING finger protein 185 | 0.0021 | 0.0016 | 0.0016 |
| Onchocerca volvulus | 0.0114 | 0.0835 | 0.082 | |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.001 | 0.1199 |
| Plasmodium falciparum | SWIB/MDM2 domain-containing protein | 0.1154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Chlamydia trachomatis | DNA topoisomerase I | 0.1154 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.002 | 0.002 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0029 | 0.0084 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0217 | 0.0628 |
| Trypanosoma brucei | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | patched 1 | 0.0051 | 0.0282 | 0.0282 |
| Brugia malayi | Zn-finger in Ran binding protein and others containing protein | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | mitochondrial RNA binding complex 1 subunit, putative | 0.041 | 0.3449 | 1 |
| Toxoplasma gondii | DNA topoisomerase domain-containing protein | 0.1154 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0217 | 0.0628 |
| Echinococcus granulosus | RING finger protein 185 | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0197 | 0.1566 | 0.1566 |
| Loa Loa (eye worm) | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Toxoplasma gondii | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Plasmodium falciparum | RING zinc finger protein, putative | 0.0021 | 0.0016 | 0.0016 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0029 | 0.0084 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Leishmania major | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Echinococcus multilocularis | ring finger protein 113a | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.017 | 0.1329 | 0.1329 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.002 | 0.002 |
| Echinococcus granulosus | sterol regulatory element binding protein | 0.0051 | 0.0282 | 0.0282 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0084 | 1 |
| Plasmodium falciparum | SWIB/MDM2 domain-containing protein | 0.1154 | 1 | 1 |
| Echinococcus granulosus | Upstream activation factor subunit UAF30 | 0.1154 | 1 | 1 |
| Onchocerca volvulus | 0.0029 | 0.0084 | 0.0068 | |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0029 | 0.0084 | 0.5 |
| Plasmodium falciparum | zinc finger Ran-binding domain-containing protein 2, putative | 0.041 | 0.3449 | 0.3449 |
| Loa Loa (eye worm) | abnormal chemotaxis protein 14 | 0.0051 | 0.0282 | 0.0282 |
| Plasmodium vivax | DNA repair protein RAD5, putative | 0.0021 | 0.0016 | 0.0016 |
| Toxoplasma gondii | Zn-finger in Ran binding protein and others domain-containing protein | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | Ankyrin repeats (3 copies)/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.0265 | 0.0265 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus granulosus | Zinc finger RanBP2 type | 0.041 | 0.3449 | 0.3449 |
| Brugia malayi | Niemann-Pick C1 protein precursor | 0.0119 | 0.088 | 0.088 |
| Echinococcus granulosus | Protein patched homolog 1 | 0.0051 | 0.0282 | 0.0282 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.0265 | 0.0265 |
| Plasmodium vivax | SWIB/MDM2 domain-containing protein, putative | 0.1154 | 1 | 1 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0217 | 0.0201 |
| Schistosoma mansoni | mind bomb | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus granulosus | SWI:SNF matrix associated | 0.1154 | 1 | 1 |
| Echinococcus multilocularis | Nuclear pore complex protein Nup153 | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma brucei | glucosidase, putative | 0.0044 | 0.0217 | 0.0628 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0051 | 0.0282 | 0.0266 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0021 | 0.002 | 0.002 |
| Echinococcus multilocularis | 0.0021 | 0.0016 | 0.0016 | |
| Echinococcus multilocularis | Zinc finger, RanBP2 type | 0.041 | 0.3449 | 0.3449 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0084 | 0.0084 |
| Giardia lamblia | Zinc finger domain | 0.0021 | 0.0016 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Mycobacterium ulcerans | hypothetical protein | 0.0029 | 0.0084 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0084 | 0.0084 |
| Schistosoma mansoni | zinc finger protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.001 | 0.1199 |
| Trypanosoma cruzi | Zn-finger in Ran binding protein and others/FYVE zinc finger, putative | 0.041 | 0.3449 | 1 |
| Loa Loa (eye worm) | SWIB/MDM2 domain-containing protein | 0.1154 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Schistosoma mansoni | inhibitor of apoptosis 1 diap1 | 0.0021 | 0.0016 | 0.0016 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0217 | 0.2324 |
| Trypanosoma brucei | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma brucei | ring finger containing protein | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | Zn-finger in Ran binding protein and others containing protein | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.041 | 0.3449 | 1 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0197 | 0.1566 | 0.1566 |
| Loa Loa (eye worm) | RiNg Finger protein family member | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | niemann-pick C1 (NPC1) | 0.0121 | 0.0896 | 0.0896 |
| Leishmania major | hypothetical protein | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.002 | 0.002 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Brugia malayi | SWIB/MDM2 domain containing protein | 0.1154 | 1 | 1 |
| Echinococcus multilocularis | tumor protein p63 | 0.0408 | 0.3428 | 0.3428 |
| Schistosoma mansoni | alpha glucosidase | 0.0044 | 0.0217 | 0.0217 |
| Echinococcus granulosus | tumor protein p63 | 0.0408 | 0.3428 | 0.3428 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.0265 | 0.0265 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0029 | 0.0084 | 0.0791 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0029 | 0.0084 | 0.0791 |
| Echinococcus multilocularis | expressed conserved protein | 0.0112 | 0.0816 | 0.0816 |
| Brugia malayi | Hypothetical RING finger protein C16C10.7 in chromosome III | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Trypanosoma brucei | Zn-finger in Ran binding protein and others/FYVE zinc finger, putative | 0.041 | 0.3449 | 1 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0029 | 0.0084 | 1 |
| Giardia lamblia | Kinase, NEK | 0.0021 | 0.0016 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Onchocerca volvulus | 0.041 | 0.3449 | 0.3438 | |
| Brugia malayi | CHE-14 protein | 0.0051 | 0.0282 | 0.0282 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0084 | 0.0244 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0217 | 0.2324 |
| Echinococcus granulosus | RING finger and transmembrane domain containing protein | 0.0021 | 0.0016 | 0.0016 |
| Trypanosoma brucei | Ankyrin repeats (3 copies)/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.041 | 0.3449 | 0.3449 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0029 | 0.0084 | 1 |
| Trypanosoma cruzi | UEV domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0217 | 0.0201 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0084 | 0.0084 |
| Trypanosoma cruzi | hypothetical protein | 0.0021 | 0.0016 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.1154 | 1 | 1 |
| Brugia malayi | Zn-finger in Ran binding protein and others containing protein | 0.041 | 0.3449 | 0.3449 |
| Echinococcus multilocularis | neutral alpha glucosidase AB | 0.0044 | 0.0217 | 0.0217 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.001 | 0.1199 |
| Schistosoma mansoni | rnf5 | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus multilocularis | protein dispatched 1 | 0.0058 | 0.0345 | 0.0345 |
| Toxoplasma gondii | ran binding protein | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | Ankyrin repeats (3 copies)/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.001 | 0.1199 |
| Plasmodium falciparum | E3 ubiquitin-protein ligase, putative | 0.0021 | 0.0016 | 0.0016 |
| Echinococcus multilocularis | zinc finger protein Ran binding | 0.041 | 0.3449 | 0.3449 |
| Trypanosoma cruzi | WLM domain containing protein, putative | 0.041 | 0.3449 | 1 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Plasmodium vivax | hypothetical protein, conserved | 0.1154 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Hypothetical protein | 0.0021 | 0.0016 | 0.5 |
| Echinococcus multilocularis | E3 ubiquitin protein ligase mib1 | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus granulosus | ring finger protein 113a | 0.0021 | 0.0016 | 0.0016 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger)/EF-hand domain pair, putative | 0.0021 | 0.0016 | 0.0046 |
| Brugia malayi | RING zinc finger protein | 0.0021 | 0.0016 | 0.0016 |
| Onchocerca volvulus | 0.041 | 0.3449 | 0.3438 | |
| Plasmodium vivax | E3 ubiquitin-protein ligase, putative | 0.0021 | 0.0016 | 0.0016 |
| Giardia lamblia | Protein 21.1 | 0.0021 | 0.0016 | 0.5 |
| Toxoplasma gondii | Bardet-Biedl syndrome 5, putative | 0.0021 | 0.0016 | 0.0016 |
| Toxoplasma gondii | hypothetical protein | 0.0021 | 0.0016 | 0.0016 |
| Schistosoma mansoni | RNA binding protein | 0.041 | 0.3449 | 0.3449 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0029 | 0.0084 | 1 |
| Trypanosoma cruzi | mitochondrial RNA binding complex 1 subunit, putative | 0.041 | 0.3449 | 1 |
| Plasmodium vivax | trophozoite exported protein 1, putative | 0.0021 | 0.0016 | 0.0016 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0021 | 0.002 | 0.2422 |
| Loa Loa (eye worm) | brahma associated protein | 0.1154 | 1 | 1 |
| Toxoplasma gondii | RING zinc finger protein | 0.0021 | 0.0016 | 0.0016 |
| Loa Loa (eye worm) | hypothetical protein | 0.0062 | 0.0383 | 0.0383 |
| Leishmania major | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Echinococcus multilocularis | SWI:SNF matrix associated | 0.1154 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma cruzi | Plus-3 domain/Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Trypanosoma brucei | Zinc finger, C3HC4 type (RING finger), putative | 0.0021 | 0.0016 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0119 | 0.088 | 0.088 |
| Toxoplasma gondii | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0217 | 0.0217 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0029 | 0.0084 | 0.0791 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (functional) | 1.122 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 3.1623 um | PUBCHEM_BIOASSAY: qHTS Assay for Rab9 Promoter Activators. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 5.6234 um | PUBCHEM_BIOASSAY: qHTS Assay for NPC1 Promoter Activators. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 6.3096 uM | PubChem BioAssay. qHTS Assay to Identify Small Molecule Activators of BRCA1 Expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 7.3078 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 8.2753 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 10 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Influenza NS1 Protein Function. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 10 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Activators of Human alpha-Glucosidase Cleavage of Glycogen. (Class of assay: confirmatory) [Related pubchem assays: 1473, 1466 ] | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PUBCHEM_BIOASSAY: qHTS for Inducers of the Endoplasmic Reticulum Stress Response (ERSR) in Human Glioma: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10.3183 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that induce genotoxicity in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493106, AID493143] | ChEMBL. | No reference |
| Potency (functional) | 10.3183 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | 10.4179 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PUBCHEM_BIOASSAY: qHTS assay for re-activators of p53 using a Luc reporter. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504709] | ChEMBL. | No reference |
| Potency (functional) | 11.9955 uM | PUBCHEM_BIOASSAY: qHTS profiling assay for firefly luciferase inhibitor/activator using purified enzyme and Km concentrations of substrates (counterscreen for miR-21 project). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2288, AID2289, AID2598, AID411] | ChEMBL. | No reference |
| Potency (functional) | 20.5962 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | = 50.1187 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Schistosoma Mansoni Peroxiredoxins. (Class of assay: confirmatory) [Related pubchem assays: 1011 (Confirmation Concentration-Response Assay for Inhibitors of the Schistosoma mansoni Redox Cascade ), 448 (Schistosoma Mansoni Peroxiredoxins (Prx2) and thioredoxin glutathione reductase (TGR) coupled assay)] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
| Potency (functional) | 56.2341 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | 89.1251 uM | PUBCHEM_BIOASSAY: Inhibitors of the vitamin D receptor (VDR): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504855] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2000445
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.