Detailed information for compound 1766769
Basic information
Technical information
- Name: Unnamed compound
- MW: 370.401 | Formula: C23H18N2O3
-
H donors: 3
H acceptors: 3
LogP: 3.77
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: ONC(=O)[C@H](c1ccccc1)NC(=O)c1ccc(cc1)C#Cc1ccccc1
- InChi: 1S/C23H18N2O3/c26-22(24-21(23(27)25-28)19-9-5-2-6-10-19)20-15-13-18(14-16-20)12-11-17-7-3-1-4-8-17/h1-10,13-16,21,28H,(H,24,26)(H,25,27)/t21-/m0/s1
- InChiKey: KHJVWCHVQMYPRJ-NRFANRHFSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Tyrosine kinase homolog | 0.0147 | 0.5381 | 0.0968 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0105 | 0.3335 | 0.3267 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Echinococcus multilocularis | somatostatin receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.0466 | 0.0369 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0055 | 0.0905 | 0.0293 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Brugia malayi | Melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Echinococcus granulosus | somatostatin receptor | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Mycobacterium tuberculosis | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0055 | 0.091 | 0.5 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0105 | 0.3331 | 0.4996 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | cell adhesion molecule | 0.0039 | 0.0101 | 0.0101 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5769 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0241 | 1 | 1 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Schistosoma mansoni | adenoreceptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | Immunoglobulin I-set domain containing protein | 0.0178 | 0.6911 | 0.6703 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0241 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3335 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.016 | 0.6036 | 0.6036 |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.016 | 0.6036 | 0.5 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0241 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0241 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0241 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0241 | 1 | 1 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.016 | 0.6036 | 0.5 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.016 | 0.6036 | 0.5 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus multilocularis | g protein coupled receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | roundabout 2 | 0.0046 | 0.0466 | 0.0466 |
| Loa Loa (eye worm) | TK/KIN16 protein kinase | 0.0178 | 0.6911 | 0.688 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.016 | 0.6036 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0241 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0241 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.016 | 0.6036 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0241 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neurotracting:lsamp:neurotrimin:obcam | 0.0039 | 0.0101 | 0.0101 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0241 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 0.5 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0241 | 1 | 1 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.016 | 0.6036 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0241 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0241 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0105 | 0.3335 | 0.4737 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0241 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0241 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0241 | 1 | 1 |
| Onchocerca volvulus | 0.0241 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.016 | 0.6036 | 0.6036 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0241 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0105 | 0.3335 | 0.3267 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.011 | 0.361 | 0.3545 |
| Schistosoma mansoni | amine GPCR | 0.0241 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0241 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.016 | 0.6036 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0241 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| MIC (functional) | = 3.2 uM | Antibacterial activity against wild-type Escherichia coli ARC523 by CLSI method | ChEMBL. | 23499237 |
| MIC (functional) | = 12 uM | Antibacterial activity against wild-type Plasmodium falciparum ARC545 by CLSI method | ChEMBL. | 23499237 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2377704
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.