Detailed information for compound 187970
Basic information
Technical information
- Name: Unnamed compound
- MW: 735.529 | Formula: C26H20F8N4Pt++
-
H donors: 0
H acceptors: 0
LogP: 7.5
Rotable bonds: 4
Rule of 5 violations (Lipinski): 2 - SMILES: Cc1cc[n+](cc1)[Pt]1([n+]2ccc(cc2)C)N(CCN1c1c(F)c(F)cc(c1F)F)c1c(F)c(F)cc(c1F)F
- InChi: 1S/C14H6F8N2.2C6H7N.Pt/c15-5-3-6(16)10(20)13(9(5)19)23-1-2-24-14-11(21)7(17)4-8(18)12(14)22;2*1-6-2-4-7-5-3-6;/h3-4H,1-2H2;2*2-5H,1H3;/q-2;;;+4
- InChiKey: YNIGNWORZXNRGX-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Giardia lamblia | Reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Leishmania major | dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus granulosus | oxidoreductase | 0.0068 | 1 | 1 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0068 | 1 | 1 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0068 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0068 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0068 | 1 | 1 |
| Leishmania major | pteridine reductase 1 | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0068 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0068 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0068 | 1 | 1 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0068 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0068 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0068 | 1 | 1 |
| Onchocerca volvulus | 0.0068 | 1 | 0.5 | |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0068 | 1 | 1 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0068 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0068 | 1 | 1 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0068 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0068 | 1 | 1 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0068 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0068 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0068 | 1 | 0.5 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0068 | 1 | 1 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0068 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0068 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0068 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0068 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0068 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase, putative | 0.0068 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0068 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ID50 (functional) | = 0.3 uM | Compound was tested against P388 cell line | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 0.8 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1 uM | Compound was evaluated invitro for its inhibitory activity againstHT-29 and BE human colon carcinoma cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 1.1 uM | Compound was evaluated invitro for its inhibitory activity against L1210/DDP leukemia cell line using MTT assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter counter assay | ChEMBL. | 1527784 |
| ID50 (functional) | = 2.7 uM | Compound was evaluated invitro for its inhibitory activity against L1210 leukemia cell line using Coulter MTT assay | ChEMBL. | 1527784 |
| T/C (functional) | = 126 % | Mean survival time of treated animals compared with those of control animals expressed as percentage. T/C was determined against murine leukemia P388 implanted mouseat the dose of 136 micromol/kg | ChEMBL. | 1527784 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: 286441
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.