Detailed information for compound 203750
Basic information
Technical information
- Name: Unnamed compound
- MW: 467.557 | Formula: C26H33N3O5
-
H donors: 3
H acceptors: 4
LogP: 4.16
Rotable bonds: 16
Rule of 5 violations (Lipinski): 1 - SMILES: CCC(C(=O)C(=O)NCc1ccccc1)NC(=O)C(NC(=O)OCc1ccccc1)CC(C)C
- InChi: 1S/C26H33N3O5/c1-4-21(23(30)25(32)27-16-19-11-7-5-8-12-19)28-24(31)22(15-18(2)3)29-26(33)34-17-20-13-9-6-10-14-20/h5-14,18,21-22H,4,15-17H2,1-3H3,(H,27,32)(H,28,31)(H,29,33)
- InChiKey: QFMKANIDVYDNPI-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Bos taurus | Cathepsin B | Starlite/ChEMBL | References |
| Homo sapiens | calpain, small subunit 1 | Starlite/ChEMBL | References |
| Homo sapiens | calpain 1, (mu/I) large subunit | References | |
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
| Homo sapiens | calpain 2, (m/II) large subunit | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Onchocerca volvulus | Cathepsin B | 335 aa | 275 aa | 24.7 % | |
| Cryptosporidium hominis | preprocathepsin c precursor | Cathepsin B | 335 aa | 280 aa | 25.7 % |
| Dictyostelium discoideum | cathepsin L-like proteinase | Cathepsin B | 335 aa | 322 aa | 26.4 % |
| Neospora caninum | hypothetical protein | Cathepsin B | 335 aa | 303 aa | 28.4 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 270 aa | 25.2 % |
| Trypanosoma cruzi | cysteine proteinase, putative | Cathepsin B | 335 aa | 276 aa | 25.7 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 297 aa | 23.6 % |
| Schistosoma mansoni | dipeptidyl-peptidase I (C01 family) | Cathepsin B | 335 aa | 275 aa | 32.7 % |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Echinococcus granulosus | calpain A | calpain 2, (m/II) large subunit | 622 aa | 663 aa | 31.2 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 271 aa | 24.4 % |
| Toxoplasma gondii | cathepsin CPC1 | Cathepsin B | 335 aa | 296 aa | 28.7 % |
| Toxoplasma gondii | preprocathepsin c precursor, putative | Cathepsin B | 335 aa | 272 aa | 24.3 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 289 aa | 22.8 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 272 aa | 25.0 % |
| Plasmodium yoelii | cathepsin c precursor | Cathepsin B | 335 aa | 313 aa | 25.2 % |
| Plasmodium knowlesi | knowpain-3 | Cathepsin B | 335 aa | 301 aa | 22.6 % |
| Trypanosoma cruzi | cysteine proteinase, putative | Cathepsin B | 335 aa | 276 aa | 26.1 % |
| Plasmodium knowlesi | knowpain-2 | Cathepsin B | 335 aa | 308 aa | 23.1 % |
| Babesia bovis | cathepsin C precursor, putative | Cathepsin B | 335 aa | 305 aa | 25.9 % |
| Dictyostelium discoideum | cysteine proteinase 5 precursor | Cathepsin B | 335 aa | 271 aa | 24.4 % |
| Onchocerca volvulus | Cathepsin L homolog | Cathepsin B | 335 aa | 316 aa | 25.6 % |
| Echinococcus granulosus | calpain A | calpain 1, (mu/I) large subunit | 714 aa | 753 aa | 31.7 % |
| Brugia malayi | Cathepsin L-like precursor | Cathepsin B | 335 aa | 312 aa | 25.0 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 271 aa | 25.1 % |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | Cathepsin B | 335 aa | 287 aa | 25.1 % |
| Dictyostelium discoideum | cysteine proteinase 3 | Cathepsin B | 335 aa | 275 aa | 28.7 % |
| Plasmodium falciparum | dipeptidyl aminopeptidase 2 | Cathepsin B | 335 aa | 312 aa | 23.7 % |
| Onchocerca volvulus | Cathepsin B | 335 aa | 326 aa | 34.7 % | |
| Plasmodium knowlesi | knowpain-4 | Cathepsin B | 335 aa | 304 aa | 25.3 % |
| Schistosoma japonicum | ko:K01275 cathepsin C [EC3.4.14.1], putative | Cathepsin B | 335 aa | 351 aa | 28.5 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 297 aa | 23.6 % |
| Giardia lamblia | Cathepsin L precursor | Cathepsin B | 335 aa | 280 aa | 25.0 % |
| Schistosoma japonicum | Cathepsin C precursor, putative | Cathepsin B | 335 aa | 289 aa | 28.4 % |
| Plasmodium berghei | dipeptidyl aminopeptidase 2 | Cathepsin B | 335 aa | 311 aa | 22.5 % |
| Plasmodium berghei | dipeptidyl aminopeptidase 1, putative | Cathepsin B | 335 aa | 313 aa | 25.6 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 271 aa | 25.1 % |
| Plasmodium vivax | dipeptidyl aminopeptidase 2, putative | Cathepsin B | 335 aa | 286 aa | 26.6 % |
| Trypanosoma congolense | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | Cathepsin B | 335 aa | 272 aa | 24.6 % |
| Onchocerca volvulus | Cathepsin B-like cysteine proteinase 6 homolog | Cathepsin B | 335 aa | 315 aa | 49.2 % |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | Cathepsin B | 335 aa | 288 aa | 26.4 % |
| Plasmodium knowlesi | dipeptidyl aminopeptidase 2, putative | Cathepsin B | 335 aa | 297 aa | 24.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0332 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0035 | 0.0115 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0132 | 0.334 | 0.334 |
| Loa Loa (eye worm) | hypothetical protein | 0.0332 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0109 | 0.2603 | 0.5 |
| Trypanosoma cruzi | calpain cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Loa Loa (eye worm) | hypothetical protein | 0.0097 | 0.2185 | 0.2185 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0109 | 0.2603 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0332 | 1 | 1 |
| Echinococcus multilocularis | hypothetical protein | 0.005 | 0.0612 | 0.0612 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0142 | 0.3671 | 0.3671 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0332 | 1 | 1 |
| Schistosoma mansoni | calpain (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Echinococcus granulosus | calpain 5 | 0.005 | 0.0612 | 0.0612 |
| Loa Loa (eye worm) | hypothetical protein | 0.0082 | 0.1688 | 0.1688 |
| Echinococcus multilocularis | family C2 unassigned peptidase (C02 family) | 0.0142 | 0.3671 | 0.3671 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.0503 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0142 | 0.3671 | 0.3671 |
| Loa Loa (eye worm) | cathepsin B | 0.0109 | 0.2603 | 0.2603 |
| Loa Loa (eye worm) | calpain 5 | 0.0035 | 0.0115 | 0.0115 |
| Schistosoma mansoni | calpain-7 (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Echinococcus granulosus | cathepsin b | 0.0332 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0332 | 1 | 1 |
| Echinococcus granulosus | calpain A | 0.005 | 0.0612 | 0.0612 |
| Brugia malayi | calpain 5 | 0.0035 | 0.0115 | 0.0115 |
| Giardia lamblia | Cathepsin B precursor | 0.0109 | 0.2603 | 0.5 |
| Brugia malayi | calpain 7 | 0.005 | 0.0612 | 0.0612 |
| Leishmania major | calpain, putative,cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.1997 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Echinococcus multilocularis | calpain A | 0.0142 | 0.368 | 0.368 |
| Echinococcus granulosus | calpain A | 0.0142 | 0.368 | 0.368 |
| Toxoplasma gondii | cathepsin B | 0.0109 | 0.2603 | 0.5 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.0503 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0097 | 0.2185 | 0.2185 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0109 | 0.2603 | 0.2603 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0132 | 0.334 | 0.334 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.0503 |
| Trypanosoma brucei | antigen, putative | 0.005 | 0.0612 | 0.1997 |
| Trypanosoma brucei | calpain-like protein, putative | 0.005 | 0.0612 | 0.1997 |
| Schistosoma mansoni | calpain C (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0132 | 0.334 | 0.334 |
| Entamoeba histolytica | calpain large subunit domain III containing protein | 0.0035 | 0.0115 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0332 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.0503 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.1997 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.0503 |
| Plasmodium vivax | calpain, putative | 0.005 | 0.0612 | 0.5 |
| Brugia malayi | calpain family protein 1 | 0.0132 | 0.334 | 0.334 |
| Brugia malayi | calpain family protein 1 | 0.0132 | 0.334 | 0.334 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0109 | 0.2603 | 0.2517 |
| Echinococcus granulosus | calpain | 0.005 | 0.0612 | 0.0612 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.1997 |
| Loa Loa (eye worm) | hypothetical protein | 0.0117 | 0.2844 | 0.2844 |
| Schistosoma mansoni | calpain-7 (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Echinococcus multilocularis | cathepsin b | 0.0332 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0109 | 0.2603 | 0.5 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0109 | 0.2603 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0332 | 1 | 1 |
| Echinococcus multilocularis | calpain | 0.005 | 0.0612 | 0.0612 |
| Trypanosoma brucei | calpain-like protein, putative | 0.005 | 0.0612 | 0.1997 |
| Giardia lamblia | Cathepsin B precursor | 0.0109 | 0.2603 | 0.5 |
| Trypanosoma brucei | calpain-like protein, putative | 0.005 | 0.0612 | 0.1997 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0332 | 1 | 1 |
| Loa Loa (eye worm) | calpain | 0.005 | 0.0612 | 0.0612 |
| Echinococcus granulosus | family C2 unassigned peptidase C02 family | 0.0142 | 0.3671 | 0.3671 |
| Echinococcus multilocularis | calpain 7 (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Echinococcus multilocularis | calpain 5 | 0.005 | 0.0612 | 0.0612 |
| Onchocerca volvulus | 0.0082 | 0.1688 | 1 | |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.005 | 0.0612 | 0.1997 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.005 | 0.0612 | 0.1997 |
| Echinococcus granulosus | calpain 7 C02 family | 0.005 | 0.0612 | 0.0612 |
| Schistosoma mansoni | Mername-AA248 (C02 family) | 0.005 | 0.0612 | 0.0612 |
| Trypanosoma brucei | calpain-like protein, putative | 0.005 | 0.0612 | 0.1997 |
| Echinococcus multilocularis | calpain family protein 1, d | 0.0097 | 0.2185 | 0.2185 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC (functional) | = 30 uM | Platelet membrane permeability. | ChEMBL. | 8831774 |
| IC50 (functional) | = 50 uM | Inhibitory potency against rat platelet membrane permeability at pH 7.35 | ChEMBL. | 8230139 |
| Ki (binding) | = 0.2 nM | Inhibition of the cysteine protease human Calpain 1 | ChEMBL. | 8831774 |
| Ki (binding) | = 0.35 nM | Compound was evaluated for the inhibition of Cysteine protease Calpain 2 | ChEMBL. | 8831774 |
| Ki (binding) | = 2 nM | Inhibition of human cathepsin B | ChEMBL. | 8831774 |
| Ki (binding) | = 0.022 uM | Inhibitory activity of alpha-keto esters towards calpain 2 at pH 8.0 | ChEMBL. | 8230139 |
| Ki (binding) | = 0.022 uM | Inhibitory activity of alpha-keto esters towards calpain 2 at pH 8.0 | ChEMBL. | 8230139 |
| Ki (binding) | = 0.2 uM | Inhibitory activity of alpha-keto esters towards calpain 1 at pH 8.0. | ChEMBL. | 8230139 |
| Ki (binding) | = 0.2 uM | Inhibitory activity of alpha-keto esters towards calpain 1 at pH 8.0. | ChEMBL. | 8230139 |
| Ki (binding) | = 0.2 uM | Inhibition of the cysteine protease human Calpain 1 | ChEMBL. | 8831774 |
| Ki (binding) | = 0.35 uM | Compound was evaluated for the inhibition of Cysteine protease Calpain 2 | ChEMBL. | 8831774 |
| Ki (binding) | = 1.3 uM | Inhibition of alpha-keto esters towards cathepsin B at pH 5.2 | ChEMBL. | 8230139 |
| Ki (binding) | = 1.3 uM | Inhibition of alpha-keto esters towards cathepsin B at pH 5.2 | ChEMBL. | 8230139 |
| Ki (binding) | = 2 uM | Inhibition of human cathepsin B | ChEMBL. | 8831774 |
| Ki (binding) | = 38 uM | Inhibitory activity of alpha-ketoesters towards papain at pH 6.0 | ChEMBL. | 8230139 |
| Ki (binding) | = 38 uM | Inhibitory activity of alpha-ketoesters towards papain at pH 6.0 | ChEMBL. | 8230139 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL118025
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.