Detailed information for compound 326243
Basic information
Technical information
- Name: Unnamed compound
- MW: 302.709 | Formula: C16H11ClO4
-
H donors: 1
H acceptors: 4
LogP: 3.44
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: OC(=O)C(=O)CC(=O)c1cc(ccc1Cl)c1ccccc1
- InChi: 1S/C16H11ClO4/c17-13-7-6-11(10-4-2-1-3-5-10)8-12(13)14(18)9-15(19)16(20)21/h1-8H,9H2,(H,20,21)
- InChiKey: DQUKQIILXHPNEG-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | flap structure-specific endonuclease 1 | Starlite/ChEMBL | References |
| Homo sapiens | excision repair cross-complementation group 5 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | exonuclease, putative | flap structure-specific endonuclease 1 | 380 aa | 322 aa | 24.5 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | DNA repair protein complementing XP G cells | 0.0044 | 0.8175 | 0.6851 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0046 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Flap endonuclease-1 | 0.0038 | 0.4204 | 0.1106 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Toxoplasma gondii | XPG N-terminal domain-containing protein | 0.0044 | 0.8175 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0046 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0044 | 0.8175 | 0.6851 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0046 | 1 | 1 |
| Giardia lamblia | Flap structure-specific endonuclease | 0.0038 | 0.4204 | 0.5 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Entamoeba histolytica | DNA-repair protein, putative | 0.0044 | 0.8175 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | myosin xvIII | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0046 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | DNA repair protein complementing XP G cells | 0.0044 | 0.8175 | 0.6851 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Brugia malayi | AKH receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0046 | 1 | 1 |
| Trypanosoma brucei | flap endonuclease-1 (FEN-1), putative | 0.0038 | 0.4204 | 0.5 |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0046 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0046 | 1 | 1 |
| Schistosoma mansoni | xp-G/rad2 DNA repair endonuclease family | 0.0044 | 0.8175 | 0.8175 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Plasmodium falciparum | DNA repair protein RAD2, putative | 0.0044 | 0.8175 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0046 | 1 | 0.5 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0046 | 1 | 1 |
| Trypanosoma cruzi | flap endonuclease-1 (FEN-1), putative | 0.0038 | 0.4204 | 0.5 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0046 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | adenoreceptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0046 | 1 | 1 |
| Trichomonas vaginalis | flap endonuclease-1, putative | 0.0044 | 0.8175 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus multilocularis | allatostatin A receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0046 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0046 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0046 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0046 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0046 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Plasmodium vivax | DNA repair protein RAD2, putative | 0.0044 | 0.8175 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0046 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0046 | 1 | 1 |
| Leishmania major | flap endonuclease-1 (FEN-1), putative | 0.0038 | 0.4204 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0046 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0046 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0046 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0046 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0046 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0046 | 1 | 1 |
| Onchocerca volvulus | 0.0046 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0046 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0046 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.33 uM | Concentration required for 50% inhibition of Flap endonuclease-1 | ChEMBL. | 15341951 |
| IC50 (binding) | = 0.33 uM | Concentration required for 50% inhibition of Flap endonuclease-1 | ChEMBL. | 15341951 |
| IC50 (binding) | = 1.13 uM | Concentration required for 50% inhibition of Xeroderma pigmentosum G | ChEMBL. | 15341951 |
| IC50 (binding) | = 1.13 uM | Concentration required for 50% inhibition of Xeroderma pigmentosum G | ChEMBL. | 15341951 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL188067
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.