Detailed information for compound 347284
Basic information
Technical information
- TDR Targets ID: 347284
- Name: N-[(2S)-1-[[(2S)-1-(4-bromophenyl)-4-(ethylam ino)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-ox obutan-2-yl]-5-(dithiolan-3-yl)pentanamide
- MW: 586.605 | Formula: C25H36BrN3O4S2
-
H donors: 3
H acceptors: 4
LogP: 4.41
Rotable bonds: 17
Rule of 5 violations (Lipinski): 2 - SMILES: CCNC(=O)C(=O)[C@H](Cc1ccc(cc1)Br)NC(=O)[C@H](C(C)C)NC(=O)CCCCC1SSCC1
- InChi: 1S/C25H36BrN3O4S2/c1-4-27-25(33)23(31)20(15-17-9-11-18(26)12-10-17)28-24(32)22(16(2)3)29-21(30)8-6-5-7-19-13-14-34-35-19/h9-12,16,19-20,22H,4-8,13-15H2,1-3H3,(H,27,33)(H,28,32)(H,29,30)/t19?,20-,22-/m0/s1
- InChiKey: QQCUMMUDLPJSFO-BXBRYHBFSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(1S)-1-[[(1S)-1-[(4-bromophenyl)methyl]-3-(ethylamino)-2,3-dioxo-propyl]carbamoyl]-2-methyl-propyl]-5-(dithiolan-3-yl)pentanamide
- N-[(1S)-1-[[[(1S)-1-[(4-bromophenyl)methyl]-3-(ethylamino)-2,3-dioxopropyl]amino]-oxomethyl]-2-methylpropyl]-5-(3-dithiolanyl)pentanamide
- N-[(2S)-1-[[(2S)-1-(4-bromophenyl)-4-(ethylamino)-3,4-dioxo-butan-2-yl]amino]-3-methyl-1-oxo-butan-2-yl]-5-(1,2-dithiolan-3-yl)pentanamide
- N-[(1S)-1-[[(1S)-1-(4-bromobenzyl)-3-(ethylamino)-2,3-diketo-propyl]carbamoyl]-2-methyl-propyl]-5-(dithiolan-3-yl)valeramide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
| Sus scrofa | Calpain 1 | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Schistosoma mansoni | calpain C (C02 family) | Calpain 1 | 714 aa | 715 aa | 33.4 % |
| Schistosoma japonicum | Calpain-9, putative | Calpain 1 | 714 aa | 671 aa | 33.8 % |
| Echinococcus granulosus | calpain A | Calpain 1 | 714 aa | 753 aa | 31.5 % |
| Echinococcus multilocularis | calpain | Calpain 1 | 714 aa | 695 aa | 38.6 % |
| Echinococcus granulosus | calpain | Calpain 1 | 714 aa | 695 aa | 38.6 % |
| Schistosoma mansoni | calpain (C02 family) | Calpain 1 | 714 aa | 684 aa | 31.0 % |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Echinococcus multilocularis | hypothetical protein | Calpain 1 | 714 aa | 716 aa | 33.1 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Toxoplasma gondii | cathepsin B | 0.0055 | 0.2688 | 0.5 |
| Echinococcus multilocularis | baculoviral IAP repeat containing protein | 0.0107 | 0.6132 | 0.5974 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0053 | 0.2551 | 0.2246 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0107 | 0.6132 | 0.5974 |
| Onchocerca volvulus | 0.0107 | 0.6132 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0055 | 0.2688 | 0.5 |
| Echinococcus multilocularis | calpain family protein 1, d | 0.0039 | 0.1637 | 0.1295 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0055 | 0.2688 | 1 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Entamoeba histolytica | protein kinase, putative | 0.0014 | 0 | 0.5 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0055 | 0.2688 | 0.2389 |
| Brugia malayi | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Echinococcus granulosus | baculoviral IAP repeat containing protein | 0.0107 | 0.6132 | 0.5974 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.1637 | 0.1637 |
| Echinococcus granulosus | inhibitor of apoptosis protein | 0.0107 | 0.6132 | 0.5974 |
| Trypanosoma brucei | antigen, putative | 0.002 | 0.0393 | 0.1462 |
| Echinococcus granulosus | family C2 unassigned peptidase C02 family | 0.0055 | 0.2708 | 0.2409 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0039 | 0.1637 | 0.1637 |
| Schistosoma mansoni | inhibitor of apoptosis protein | 0.0107 | 0.6132 | 0.5974 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Echinococcus multilocularis | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Loa Loa (eye worm) | cathepsin B | 0.0055 | 0.2688 | 0.2688 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Echinococcus granulosus | calpain A | 0.0055 | 0.2708 | 0.2409 |
| Echinococcus multilocularis | inhibitor of apoptosis protein | 0.0107 | 0.6132 | 0.5974 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0055 | 0.2688 | 0.2688 |
| Trypanosoma cruzi | calpain cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | calpain | 0.002 | 0.0393 | 0.0393 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.2158 | 0.2158 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Entamoeba histolytica | calpain large subunit domain III containing protein | 0.0014 | 0 | 0.5 |
| Leishmania major | calpain, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Brugia malayi | Inhibitor of Apoptosis domain containing protein | 0.0107 | 0.6132 | 0.6132 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.1462 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0055 | 0.2688 | 1 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 1 | 1 |
| Echinococcus multilocularis | calpain A | 0.0055 | 0.2708 | 0.2409 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.6132 | 0.6132 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.1244 | 0.1244 |
| Brugia malayi | calpain 7 | 0.002 | 0.0393 | 0.0393 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Brugia malayi | Inhibitor of Apoptosis domain containing protein | 0.0107 | 0.6132 | 0.6132 |
| Schistosoma mansoni | inhibitor of apoptosis (iap) domain family member | 0.0107 | 0.6132 | 0.5974 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Brugia malayi | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Loa Loa (eye worm) | hypothetical protein | 0.0053 | 0.2551 | 0.2551 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0166 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0107 | 0.6132 | 0.6132 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Plasmodium vivax | calpain, putative | 0.002 | 0.0393 | 0.5 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Onchocerca volvulus | Deterin homolog | 0.0107 | 0.6132 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | = 27.5 % | Increase in muscle fiber diameter size in mdx mice, 20mg/kg | ChEMBL. | 16185867 |
| Activity (functional) | = 27.5 % | Increase in muscle fiber diameter size in mdx mice, 20mg/kg | ChEMBL. | 16185867 |
| IC50 (binding) | = 0.04 uM | Inhibtory activity against cathepsin B | ChEMBL. | 16185867 |
| IC50 (binding) | = 0.04 uM | Inhibtory activity against cathepsin B | ChEMBL. | 16185867 |
| IC50 (binding) | = 0.06 uM | Inhibitory activity against porcine calpain I using Suc-Leu-Tyr-AMC fluorogenic substrate | ChEMBL. | 16185867 |
| IC50 (binding) | = 0.06 uM | Inhibitory activity against porcine calpain I using Suc-Leu-Tyr-AMC fluorogenic substrate | ChEMBL. | 16185867 |
| IC50 (binding) | = 0.18 uM | Inhibitory activity against 20S proteasome | ChEMBL. | 16185867 |
| IC50 (functional) | = 0.2 uM | Inhibition of calpain I in C2C12 myoblasts loaded with Suc-Leu-Tyr-AMC | ChEMBL. | 16185867 |
| Inhibition (binding) | = 0 % | Inhibition of caspase 3 at 10 uM | ChEMBL. | 16185867 |
| Inhibition (binding) | = 0 % | Inhibition of thrombin at 10 uM | ChEMBL. | 16185867 |
| Inhibition (binding) | = 0 % | Inhibition of caspase 3 at 10 uM | ChEMBL. | 16185867 |
| Inhibition (binding) | = 0 % | Inhibition of thrombin at 10 uM | ChEMBL. | 16185867 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL200283
- PubChem: 11592350
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.