Detailed information for compound 36021

Basic information

Technical information
  • Name: Unnamed compound
  • MW: 345.476 | Formula: C21H31NO3
  • H donors: 1 H acceptors: 1 LogP: 3.37 Rotable bonds: 4
    Rule of 5 violations (Lipinski): 1
  • SMILES: CCOc1cc2c(cc1OCC)CCN1[C@H]2C[C@@H]2C[C@H](O)CCC2C1
  • InChi: 1S/C21H31NO3/c1-3-24-20-11-14-7-8-22-13-15-5-6-17(23)9-16(15)10-19(22)18(14)12-21(20)25-4-2/h11-12,15-17,19,23H,3-10,13H2,1-2H3/t15?,16-,17+,19-/m0/s1
  • InChiKey: ANDOQLXQJYNBHQ-PHSGOXPASA-N  


Substructure search Similarity search

Network

Hover on a compound node to display the structore

Synonyms

No synonyms found for this compound

Targets

Known targets for this compound

Species Target name Source Bibliographic reference
Rattus norvegicus Adrenergic receptor alpha-2 Starlite/ChEMBL References

Predicted pathogen targets for this compound

By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
Species Potential target Known druggable target Length Alignment span Identity
Echinococcus multilocularis serotonin receptor Adrenergic receptor alpha-2   450 aa 426 aa 31.9 %
Schistosoma mansoni amine GPCR Adrenergic receptor alpha-2   450 aa 439 aa 29.2 %
Onchocerca volvulus Adrenergic receptor alpha-2   450 aa 420 aa 19.8 %
Echinococcus multilocularis neuropeptides capa receptor Adrenergic receptor alpha-2   450 aa 486 aa 20.6 %
Schistosoma mansoni biogenic amine (5HT) receptor Adrenergic receptor alpha-2   450 aa 433 aa 27.9 %
Loa Loa (eye worm) TYRA-2 protein Adrenergic receptor alpha-2   450 aa 488 aa 23.8 %
Echinococcus multilocularis fmrfamide receptor Adrenergic receptor alpha-2   450 aa 366 aa 19.9 %
Echinococcus granulosus alpha 1A adrenergic receptor Adrenergic receptor alpha-2   450 aa 476 aa 21.0 %
Schistosoma japonicum ko:K04145 dopamine receptor D2, putative Adrenergic receptor alpha-2   450 aa 473 aa 24.1 %
Echinococcus multilocularis alpha 1A adrenergic receptor Adrenergic receptor alpha-2   450 aa 478 aa 20.7 %
Echinococcus granulosus biogenic amine 5HT receptor Adrenergic receptor alpha-2   450 aa 423 aa 31.7 %
Onchocerca volvulus Adrenergic receptor alpha-2   450 aa 467 aa 25.1 %
Schistosoma japonicum ko:K04207 neuropeptide Y receptor Y5, putative Adrenergic receptor alpha-2   450 aa 378 aa 20.9 %
Obtained from network model

Ranking Plot

Putative Targets List

Species Potential target Raw Global Species
Echinococcus multilocularis serine threonine protein kinase 0.0018 0.5 0.5
Entamoeba histolytica C2 domain protein, putative 0.0018 0.5 0.5
Echinococcus multilocularis Protein kinase C, brain isozyme 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Toxoplasma gondii ferlin family protein 0.0018 0.5 0.5
Schistosoma mansoni protein kinase C 0.0018 0.5 0.5
Echinococcus granulosus 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase beta-4 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Trypanosoma cruzi synaptotagmin, putative 0.0018 0.5 0.5
Trypanosoma brucei C2 domain containing protein, putative 0.0018 0.5 0.5
Trichomonas vaginalis copine, putative 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Schistosoma mansoni subfamily C1A unassigned peptidase (C01 family) 0.0018 0.5 0.5
Schistosoma mansoni serine/threonine protein kinase 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin 1,2, putative 0.0018 0.5 0.5
Brugia malayi Synaptotagmin I 0.0018 0.5 0.5
Trypanosoma brucei C2 domain/Ankyrin repeats (3 copies), putative 0.0018 0.5 0.5
Schistosoma mansoni E3 ubiquitin-protein ligase nedd-4 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis ion channel nompc, putative 0.0018 0.5 0.5
Trichomonas vaginalis copine, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis myoferlin 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Echinococcus granulosus active breakpoint cluster region 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Trypanosoma brucei hypothetical protein, conserved 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Echinococcus granulosus neural cell expressed developmentally 0.0018 0.5 0.5
Trypanosoma cruzi cAMP binding protein, putative 0.0018 0.5 0.5
Echinococcus multilocularis 1 phosphatidylinositol 4,5 bisphosphate 0.0018 0.5 0.5
Loa Loa (eye worm) synaptotagmin-1 0.0018 0.5 0.5
Schistosoma mansoni mctp-related 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein, conserved 0.0018 0.5 0.5
Toxoplasma gondii Elicitor-responsive protein, putative 0.0018 0.5 0.5
Trypanosoma brucei hypothetical protein, conserved 0.0018 0.5 0.5
Brugia malayi Synaptotagmin protein 3 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Brugia malayi phospholipase C homolog 0.0018 0.5 0.5
Echinococcus multilocularis UNCoordinated family member (unc 13) 0.0018 0.5 0.5
Echinococcus granulosus intersectin 2 0.0018 0.5 0.5
Echinococcus multilocularis active breakpoint cluster region 0.0018 0.5 0.5
Echinococcus granulosus NEDD4 E3 ubiquitin protein ligase WWP1 0.0018 0.5 0.5
Echinococcus granulosus otoferlin 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Toxoplasma gondii Sma protein 0.0018 0.5 0.5
Echinococcus granulosus Protein kinase C brain isozyme 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica calcium-binding protein, putative 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Leishmania major copine i-like protein 0.0018 0.5 0.5
Echinococcus granulosus protein kinase c epsilon type 0.0018 0.5 0.5
Echinococcus granulosus multiple C2 and transmembrane domain containing protein 0.0018 0.5 0.5
Echinococcus granulosus calpain 5 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Trypanosoma cruzi cytoskeleton associated protein, putative 0.0018 0.5 0.5
Toxoplasma gondii hypothetical protein 0.0018 0.5 0.5
Trypanosoma brucei Coiled-coil and C2 domain-containing protein 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trypanosoma cruzi phosphoinositide-specific phospholipase C, putative 0.0018 0.5 0.5
Brugia malayi calpain 5 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis intersectin 2 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin-like protein 0.0018 0.5 0.5
Echinococcus multilocularis protein piccolo 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Toxoplasma gondii C2 domain-containing protein 0.0018 0.5 0.5
Brugia malayi protein kinase C II. 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 15 0.0018 0.5 0.5
Schistosoma mansoni phospholipase C-like protein 2 plc-L2 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Onchocerca volvulus Multiple C2 domain and transmembrane region protein homolog 0.0018 0.5 0.5
Schistosoma mansoni hypothetical protein 0.0018 0.5 0.5
Brugia malayi Copine VIII 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Brugia malayi Synapse defective protein 1 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium lipid binding region CaLB 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis copine, putative 0.0018 0.5 0.5
Plasmodium vivax double C2-like domain-containing protein, putative 0.0018 0.5 0.5
Trypanosoma cruzi C2 domain/Ankyrin repeats (3 copies), putative 0.0018 0.5 0.5
Echinococcus multilocularis multiple C2 and transmembrane domain containing protein 0.0018 0.5 0.5
Entamoeba histolytica Rap/Ran GTPase activating protein, putative 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 0.0018 0.5 0.5
Echinococcus granulosus myoferlin 0.0018 0.5 0.5
Trichomonas vaginalis calcium-dependent lipid-binding protein, putative 0.0018 0.5 0.5
Brugia malayi Variant SH3 domain containing protein 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium lipid binding region, CaLB 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Echinococcus granulosus copine 9 0.0018 0.5 0.5
Toxoplasma gondii hypothetical protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus multilocularis 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Plasmodium vivax ferlin, putative 0.0018 0.5 0.5
Brugia malayi Phosphatidylinositol-specific phospholipase C, X domain containing protein 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 0.0018 0.5 0.5
Trypanosoma brucei predicted C2 domain protein 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 12 0.0018 0.5 0.5
Trichomonas vaginalis annexin VII, putative 0.0018 0.5 0.5
Trichomonas vaginalis Circumsporozoite protein precursor, putative 0.0018 0.5 0.5
Echinococcus multilocularis protein kinase c epsilon type 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 0.0018 0.5 0.5
Trypanosoma cruzi Coiled-coil and C2 domain-containing protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 2 0.0018 0.5 0.5
Loa Loa (eye worm) copine family protein 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus multilocularis unc 13 (munc13) 0.0018 0.5 0.5
Loa Loa (eye worm) variant SH3 domain-containing protein 0.0018 0.5 0.5
Toxoplasma gondii phosphoinositide phospholipase PIPLC 0.0018 0.5 0.5
Trichomonas vaginalis copine, putative 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Plasmodium falciparum ferlin, putative 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Trypanosoma cruzi synaptotagmin, putative 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Schistosoma mansoni fer-1-related 0.0018 0.5 0.5
Schistosoma mansoni nedd-4-like E3 ubiquitin-protein ligase 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis copine 9 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 2 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin 1, 3, C.elegans, putative 0.0018 0.5 0.5
Loa Loa (eye worm) phosphatidylinositol-specific phospholipase C 0.0018 0.5 0.5
Echinococcus granulosus protein kinase C gamma type 0.0018 0.5 0.5
Trypanosoma brucei C2 domain containing protein, putative 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni otoferlin 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin protein 4 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trypanosoma brucei C2 domain containing protein, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 0.0018 0.5 0.5
Brugia malayi Protein kinase c protein 2 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Schistosoma mansoni regulator of G protein signaling 3 rgs3 0.0018 0.5 0.5
Trypanosoma cruzi C2 domain containing protein, putative 0.0018 0.5 0.5
Schistosoma mansoni hypothetical protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus multilocularis extended synaptotagmin 2 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus granulosus extended synaptotagmin 2 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Echinococcus multilocularis calpain 5 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Plasmodium vivax hypothetical protein, conserved 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Trichomonas vaginalis Proline-rich protein, putative 0.0018 0.5 0.5
Brugia malayi Synapse defective protein 1 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Echinococcus granulosus unc 13 munc13 0.0018 0.5 0.5
Trypanosoma brucei C2 domain containing protein, putative 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 0.0018 0.5 0.5
Onchocerca volvulus Putative cc2d1b protein 0.0018 0.5 0.5
Trichomonas vaginalis splicing factor 3A subunit, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni serine/threonine protein kinase 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trypanosoma brucei predicted C2 domain protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Toxoplasma gondii hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni serine/threonine protein kinase 0.0018 0.5 0.5
Schistosoma mansoni unc-13 (munc13) 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Plasmodium falciparum ferlin, putative 0.0018 0.5 0.5
Brugia malayi NEDD4.2 0.0018 0.5 0.5
Echinococcus multilocularis multiple C2 and transmembrane domain containing protein 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni unc-13 (munc13) 0.0018 0.5 0.5
Loa Loa (eye worm) AGC/PKC/ALPHA protein kinase 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis neural cell expressed, developmentally 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica protein kinase, putative 0.0018 0.5 0.5
Schistosoma mansoni rab3 interacting molecule (rim)-related 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin 1, 3, C.elegans, putative 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium lipid binding region, CaLB 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 0.0018 0.5 0.5
Entamoeba histolytica DENN domain protein 0.0018 0.5 0.5
Brugia malayi Copine family protein 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin 15 0.0018 0.5 0.5
Brugia malayi Phosphatidylinositol 3- and 4-kinase family protein 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Brugia malayi WW domain containing protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Entamoeba histolytica protein kinase, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Plasmodium falciparum double C2-like domain-containing protein 0.0018 0.5 0.5
Trypanosoma cruzi hypothetical protein, conserved 0.0018 0.5 0.5
Trichomonas vaginalis ankyrin repeat-containing protein, putative 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Loa Loa (eye worm) C2 domain-containing protein 0.0018 0.5 0.5
Plasmodium vivax ferlin, putative 0.0018 0.5 0.5
Trichomonas vaginalis vab10 spectraplakin, putative 0.0018 0.5 0.5
Leishmania major c2 domain protein, putative 0.0018 0.5 0.5
Entamoeba histolytica hypothetical protein, conserved 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Brugia malayi LD23056p 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Schistosoma mansoni rho gtpase activating protein 0.0018 0.5 0.5
Echinococcus granulosus protein piccolo 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni Mername-AA248 (C02 family) 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Echinococcus granulosus C2 calcium lipid binding region CaLB 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Trichomonas vaginalis copine, putative 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Onchocerca volvulus 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus granulosus multiple C2 and transmembrane domain containing protein 0.0018 0.5 0.5
Schistosoma mansoni unc-13 (munc13) 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Schistosoma mansoni synaptotagmin 12 0.0018 0.5 0.5
Echinococcus multilocularis copine 9 0.0018 0.5 0.5
Plasmodium falciparum conserved Plasmodium protein, unknown function 0.0018 0.5 0.5
Loa Loa (eye worm) AGC/PKC/ETA protein kinase 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Loa Loa (eye worm) Nedd4-PD 0.0018 0.5 0.5
Trypanosoma brucei phosphoinositide-specific phospholipase C 0.0018 0.5 0.5
Leishmania major phospholipase c-like protein 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Echinococcus multilocularis synaptotagmin protein 4 0.0018 0.5 0.5
Echinococcus multilocularis NEDD4 E3 ubiquitin protein ligase WWP1 0.0018 0.5 0.5
Leishmania major hypothetical protein, conserved 0.0018 0.5 0.5
Loa Loa (eye worm) phosphatidylinositol 3-kinase catalytic subunit gamma 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Echinococcus granulosus copine 9 0.0018 0.5 0.5
Echinococcus multilocularis C2 calcium dependent membrane targeting 0.0018 0.5 0.5
Schistosoma mansoni hypothetical protein 0.0018 0.5 0.5
Brugia malayi C2 domain containing protein 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin 1,2, putative 0.0018 0.5 0.5
Trypanosoma brucei synaptotagmin, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Trypanosoma cruzi cytoskeleton associated protein, putative 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni synaptic ras gtpase activating protein syngap 0.0018 0.5 0.5
Trichomonas vaginalis conserved hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni rabphilin-3a 0.0018 0.5 0.5
Schistosoma mansoni copine 0.0018 0.5 0.5
Entamoeba histolytica C2 domain containing protein 0.0018 0.5 0.5
Schistosoma mansoni glut4 vesicle protein-related 0.0018 0.5 0.5
Schistosoma mansoni phosphatidylinositol-45-bisphosphate 3-kinase catalytic subunit alpha PI3K 0.0018 0.5 0.5
Trypanosoma brucei predicted C2 domain protein 0.0018 0.5 0.5
Echinococcus granulosus Immunoglobulin E set 0.0018 0.5 0.5
Trypanosoma brucei cAMP binding protein, putative 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 0.0018 0.5 0.5
Echinococcus granulosus UNCoordinated family member unc 13 0.0018 0.5 0.5
Leishmania major c2 domain protein, putative 0.0018 0.5 0.5
Echinococcus granulosus synaptotagmin 0.0018 0.5 0.5
Trichomonas vaginalis synaptotagmin 1,2, putative 0.0018 0.5 0.5
Loa Loa (eye worm) hypothetical protein 0.0018 0.5 0.5
Schistosoma mansoni hypothetical protein 0.0018 0.5 0.5

Activities

Activity type Activity value Assay description Source Reference
Kd (functional) > 4 Antagonistic activity against postsynaptic Alpha-1 adrenergic receptor in isolated rat vas deferens using (-)-phenylephrine as agonist ChEMBL. 2886664
Kd (functional) = 6.41 Antagonistic activity against presynaptic alpha-2 adrenergic receptor in isolated rat vas deferens using xylazine as agonist ChEMBL. 2886664
pA2 (functional) < 4 Antagonistic activity against postsynaptic Alpha-1 adrenergic receptor in isolated rat vas deferens using (-)-phenylephrine as agonist ChEMBL. 2886664
pA2 (functional) = 6.41 Antagonistic activity against presynaptic alpha-2 adrenergic receptor in isolated rat vas deferens using xylazine as agonist ChEMBL. 2886664
Selectivity (binding) > 257 Selectivity ratio of the compound (Alpha-1 : Alpha-2) ChEMBL. 2886664

Phenotypes

Whole-cell/tissue/organism interactions

We have no records of whole-cell/tissue assays done with this compound What does this mean?

Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.

Annotated phenotypes:

We have no manually annotated phenotypes for this drug. What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by drugs, or by genetic manipulation of cells (e.g. gene knockouts or knockdowns) is manually curated from the literature. These descriptions help to describe the potential of the target for drug development. If no information is available for this gene or if the information is incomplete, this may mean that i) the papers containing this information either appeared after the curation effort for this organism was carried out or they were inadvertently missed by curators; or that ii) the curation effort for this organism has not yet started.
 
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.

External resources for this compound

No external resources registered for this compound

Bibliographic References

1 literature reference was collected for this gene.

If you have references for this compound, please enter them in a user comment (below) or Contact us.