Detailed information for compound 369557
Basic information
Technical information
- TDR Targets ID: 369557
- Name: (2R)-1-(4-chlorophenyl)sulfonyl-N-(1-oxo-3-ph enylpropan-2-yl)pyrrolidine-2-carboxamide
- MW: 420.91 | Formula: C20H21ClN2O4S
-
H donors: 1
H acceptors: 4
LogP: 3.09
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: O=CC(Cc1ccccc1)NC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(cc1)Cl
- InChi: 1S/C20H21ClN2O4S/c21-16-8-10-18(11-9-16)28(26,27)23-12-4-7-19(23)20(25)22-17(14-24)13-15-5-2-1-3-6-15/h1-3,5-6,8-11,14,17,19H,4,7,12-13H2,(H,22,25)/t17?,19-/m1/s1
- InChiKey: KLZXCTGYJSIODJ-WHCXFUJUSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (2R)-N-(1-benzyl-2-oxo-ethyl)-1-(4-chlorophenyl)sulfonyl-pyrrolidine-2-carboxamide
- (2R)-N-(1-benzyl-2-oxoethyl)-1-(4-chlorophenyl)sulfonyl-2-pyrrolidinecarboxamide
- (2R)-1-(4-chlorophenyl)sulfonyl-N-(1-oxo-3-phenyl-propan-2-yl)pyrrolidine-2-carboxamide
- (2R)-N-(1-benzyl-2-keto-ethyl)-1-(4-chlorophenyl)sulfonyl-pyrrolidine-2-carboxamide
- (2R)-1-(4-chlorophenyl)sulfonyl-N-(1-formyl-2-phenyl-ethyl)pyrrolidine-2-carboxamide
- (2R)-1-(4-chlorophenyl)sulfonyl-N-(1-formyl-2-phenylethyl)-2-pyrrolidinecarboxamide
- (2R)-N-[1-(benzyl)-2-keto-ethyl]-1-(4-chlorophenyl)sulfonyl-pyrrolidine-2-carboxamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Sus scrofa | Calpain 1 | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Schistosoma japonicum | Calpain-9, putative | Calpain 1 | 714 aa | 671 aa | 33.8 % |
| Schistosoma mansoni | calpain C (C02 family) | Calpain 1 | 714 aa | 715 aa | 33.4 % |
| Echinococcus granulosus | calpain A | Calpain 1 | 714 aa | 753 aa | 31.5 % |
| Echinococcus granulosus | calpain | Calpain 1 | 714 aa | 695 aa | 38.6 % |
| Echinococcus multilocularis | calpain | Calpain 1 | 714 aa | 695 aa | 38.6 % |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Schistosoma mansoni | calpain (C02 family) | Calpain 1 | 714 aa | 684 aa | 31.0 % |
| Echinococcus multilocularis | hypothetical protein | Calpain 1 | 714 aa | 716 aa | 33.1 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0039 | 0.1637 | 0.1637 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0055 | 0.2688 | 0.5 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | hypothetical protein | 0.0053 | 0.2551 | 0.2551 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0055 | 0.2688 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Loa Loa (eye worm) | calpain | 0.002 | 0.0393 | 0.0393 |
| Echinococcus multilocularis | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.1244 | 0.1244 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Loa Loa (eye worm) | cathepsin B | 0.0055 | 0.2688 | 0.2688 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Toxoplasma gondii | cathepsin B | 0.0055 | 0.2688 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0014 | 0 | 0.5 |
| Brugia malayi | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 1 | 1 |
| Entamoeba histolytica | calpain large subunit domain III containing protein | 0.0014 | 0 | 0.5 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 1 | 1 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0166 | 1 | 1 |
| Plasmodium vivax | calpain, putative | 0.002 | 0.0393 | 0.5 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0053 | 0.2551 | 0.2246 |
| Brugia malayi | calpain family protein 1 | 0.0053 | 0.2551 | 0.2551 |
| Loa Loa (eye worm) | hypothetical protein | 0.0047 | 0.2158 | 0.2158 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0166 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0055 | 0.2688 | 0.2688 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 1 | 1 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0055 | 0.2688 | 0.2389 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0055 | 0.2708 | 0.2409 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.0393 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma brucei | calpain-like protein, putative | 0.002 | 0.0393 | 0.1462 |
| Echinococcus multilocularis | calpain family protein 1, d | 0.0039 | 0.1637 | 0.1295 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.1637 | 0.1637 |
| Echinococcus multilocularis | calpain A | 0.0055 | 0.2708 | 0.2409 |
| Leishmania major | calpain, putative,cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C2, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Echinococcus granulosus | family C2 unassigned peptidase C02 family | 0.0055 | 0.2708 | 0.2409 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0055 | 0.2688 | 1 |
| Onchocerca volvulus | 0.0033 | 0.1244 | 0.5 | |
| Brugia malayi | calpain 7 | 0.002 | 0.0393 | 0.0393 |
| Echinococcus granulosus | calpain A | 0.0055 | 0.2708 | 0.2409 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.002 | 0.0393 | 0.1462 |
| Trypanosoma brucei | antigen, putative | 0.002 | 0.0393 | 0.1462 |
| Giardia lamblia | Cathepsin B precursor | 0.0055 | 0.2688 | 0.5 |
| Trypanosoma cruzi | calpain cysteine peptidase, putative | 0.002 | 0.0393 | 0.0393 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Ki (binding) | = 0.141 uM | Inhibition of porcine erythrocyte mu calpain | ChEMBL. | 16913717 |
| Ki (binding) | = 0.141 uM | Inhibition of porcine erythrocyte mu calpain | ChEMBL. | 16913717 |
| Ki (binding) | = 5.4 uM | Inhibition of human liver cathepsin B | ChEMBL. | 16913717 |
| Ki (binding) | = 5.4 uM | Inhibition of human liver cathepsin B | ChEMBL. | 16913717 |
| Selectivity ratio (binding) | = 38.2 | Selectivity ratio, Ki for human cathepsin B/Ki for porcine mu calpain | ChEMBL. | 16913717 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL213209
- PubChem: 11849752
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.