Detailed information for compound 431776
Basic information
Technical information
- TDR Targets ID: 431776
- Name: 2-(1,3-benzodioxol-5-ylmethyl)-4-chloro-6-(4- imidazol-1-ylphenoxy)pyrimidine
- MW: 406.822 | Formula: C21H15ClN4O3
-
H donors: 0
H acceptors: 3
LogP: 4.55
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cc(Oc2ccc(cc2)n2cncc2)nc(n1)Cc1ccc2c(c1)OCO2
- InChi: 1S/C21H15ClN4O3/c22-19-11-21(29-16-4-2-15(3-5-16)26-8-7-23-12-26)25-20(24-19)10-14-1-6-17-18(9-14)28-13-27-17/h1-9,11-12H,10,13H2
- InChiKey: UWYBYGPZJAMGQU-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-(1,3-benzodioxol-5-ylmethyl)-4-chloro-6-[4-(1-imidazolyl)phenoxy]pyrimidine
- 4-chloro-6-(4-imidazol-1-ylphenoxy)-2-piperonyl-pyrimidine
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | nitric oxide synthase 2, inducible | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Synapse defective protein 1 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | calpain 5 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | copine 9 | 0.0121 | 1 | 1 |
| Plasmodium vivax | ferlin, putative | 0.0121 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | AGC/PKC/ALPHA protein kinase | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | protein kinase c epsilon type | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | nedd-4-like E3 ubiquitin-protein ligase | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0121 | 1 | 1 |
| Leishmania major | p450 reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | active breakpoint cluster region | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | 1 phosphatidylinositol 4,5 bisphosphate | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Synaptotagmin protein 3 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Leishmania major | c2 domain protein, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | copine 9 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | synaptotagmin-1 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | otoferlin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | phosphatidylinositol-specific phospholipase C | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | AGC/PKC/ETA protein kinase | 0.0121 | 1 | 1 |
| Echinococcus granulosus | copine 9 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptic ras gtpase activating protein syngap | 0.0121 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0029 | 0.0861 | 0.5 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | FAD binding domain-containing protein | 0.0032 | 0.1225 | 0.1225 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0121 | 1 | 1 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Entamoeba histolytica | DENN domain protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Echinococcus multilocularis | unc 13 (munc13) | 0.0121 | 1 | 1 |
| Entamoeba histolytica | Rap/Ran GTPase activating protein, putative | 0.0121 | 1 | 0.5 |
| Echinococcus multilocularis | myoferlin | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | C2 domain/Ankyrin repeats (3 copies), putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Plasmodium vivax | ferlin, putative | 0.0121 | 1 | 1 |
| Plasmodium falciparum | ferlin, putative | 0.0121 | 1 | 1 |
| Mycobacterium ulcerans | formate dehydrogenase H FdhF | 0.0032 | 0.1225 | 0.5 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | C2 domain-containing protein | 0.0121 | 1 | 0.5 |
| Trypanosoma cruzi | cAMP binding protein, putative | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0032 | 0.1225 | 0.1225 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | extended synaptotagmin 2 | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain protein, putative | 0.0121 | 1 | 0.5 |
| Trypanosoma brucei | Coiled-coil and C2 domain-containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Echinococcus granulosus | Immunoglobulin E set | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Leishmania major | c2 domain protein, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase beta-4 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | protein kinase C | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NADPH dependent diflavin oxidoreductase 1 | 0.0032 | 0.1225 | 0.1225 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Leishmania major | phospholipase c-like protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | sulfite reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Echinococcus granulosus | active breakpoint cluster region | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | calcium-dependent lipid-binding protein, putative | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | Coiled-coil and C2 domain-containing protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Echinococcus granulosus | extended synaptotagmin 2 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NADPH cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0121 | 1 | 0.5 |
| Trypanosoma cruzi | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Plasmodium vivax | NADPH-cytochrome p450 reductase, putative | 0.0032 | 0.1225 | 0.0399 |
| Echinococcus multilocularis | neural cell expressed, developmentally | 0.0121 | 1 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | FAD binding domain containing protein | 0.0032 | 0.1225 | 0.1225 |
| Trichomonas vaginalis | Proline-rich protein, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | phosphoinositide-specific phospholipase C | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | serine threonine protein kinase | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | annexin VII, putative | 0.0121 | 1 | 1 |
| Giardia lamblia | Nitric oxide synthase, inducible | 0.0029 | 0.0861 | 0.5 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Brugia malayi | protein kinase C II. | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | Variant SH3 domain containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Schistosoma mansoni | phospholipase C-like protein 2 plc-L2 | 0.0121 | 1 | 1 |
| Leishmania major | NADPH-cytochrome p450 reductase-like protein | 0.0032 | 0.1225 | 0.0399 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Protein kinase c protein 2 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | phospholipase C homolog | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | intersectin 2 | 0.0121 | 1 | 1 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | Synaptotagmin I | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Echinococcus multilocularis | copine 9 | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | C2 domain containing protein, putative | 0.0121 | 1 | 1 |
| Leishmania major | copine i-like protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | copine | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | protein piccolo | 0.0121 | 1 | 1 |
| Echinococcus granulosus | protein kinase c epsilon type | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | rabphilin-3a | 0.0121 | 1 | 1 |
| Toxoplasma gondii | Elicitor-responsive protein, putative | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | Multiple C2 domain and transmembrane region protein homolog | 0.0121 | 1 | 0.5 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin 2 | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | rho gtpase activating protein | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | Phosphatidylinositol 3- and 4-kinase family protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | Putative cc2d1b protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0121 | 1 | 1 |
| Trypanosoma brucei | cAMP binding protein, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin 15 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | Nedd4-PD | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | regulator of G protein signaling 3 rgs3 | 0.0121 | 1 | 1 |
| Toxoplasma gondii | Sma protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | Circumsporozoite protein precursor, putative | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | unc 13 munc13 | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | otoferlin | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | calpain 5 | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | calcium-binding protein, putative | 0.0121 | 1 | 0.5 |
| Plasmodium falciparum | double C2-like domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | intersectin 2 | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin protein 4 | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | glut4 vesicle protein-related | 0.0121 | 1 | 1 |
| Brugia malayi | WW domain containing protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | Synapse defective protein 1 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | myoferlin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Chlamydia trachomatis | sulfite reductase | 0.002 | 0 | 0.5 |
| Echinococcus multilocularis | synaptotagmin | 0.0121 | 1 | 1 |
| Schistosoma mansoni | mctp-related | 0.0121 | 1 | 1 |
| Echinococcus granulosus | UNCoordinated family member unc 13 | 0.0121 | 1 | 1 |
| Plasmodium vivax | double C2-like domain-containing protein, putative | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | calpain 5 | 0.0121 | 1 | 1 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | 0.0121 | 1 | 1 | |
| Trypanosoma brucei | C2 domain/Ankyrin repeats (3 copies), putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | fer-1-related | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | vab10 spectraplakin, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | rab3 interacting molecule (rim)-related | 0.0121 | 1 | 1 |
| Brugia malayi | Copine VIII | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0121 | 1 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0121 | 1 | 0.5 |
| Loa Loa (eye worm) | copine family protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NADPH dependent diflavin oxidoreductase 1 | 0.0032 | 0.1225 | 0.1225 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | Copine family protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Toxoplasma gondii | hypothetical protein | 0.0121 | 1 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | phosphatidylinositol-45-bisphosphate 3-kinase catalytic subunit alpha PI3K | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Trypanosoma cruzi | phosphoinositide-specific phospholipase C, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Brugia malayi | Phosphatidylinositol-specific phospholipase C, X domain containing protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | synaptotagmin 15 | 0.0121 | 1 | 1 |
| Toxoplasma gondii | ferlin family protein | 0.0121 | 1 | 0.5 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | ion channel nompc, putative | 0.0121 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0121 | 1 | 0.5 |
| Schistosoma mansoni | Mername-AA248 (C02 family) | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | splicing factor 3A subunit, putative | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | phosphatidylinositol 3-kinase catalytic subunit gamma | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0121 | 1 | 1 |
| Plasmodium falciparum | ferlin, putative | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | synaptotagmin protein 4 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Toxoplasma gondii | phosphoinositide phospholipase PIPLC | 0.0121 | 1 | 0.5 |
| Echinococcus granulosus | synaptotagmin 2 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0121 | 1 | 1 |
| Echinococcus granulosus | Protein kinase C brain isozyme | 0.0121 | 1 | 1 |
| Brugia malayi | LD23056p | 0.0121 | 1 | 1 |
| Onchocerca volvulus | 0.0121 | 1 | 0.5 | |
| Echinococcus granulosus | protein kinase C gamma type | 0.0121 | 1 | 1 |
| Schistosoma mansoni | synaptotagmin-like protein | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | Protein kinase C, brain isozyme | 0.0121 | 1 | 1 |
| Schistosoma mansoni | E3 ubiquitin-protein ligase nedd-4 | 0.0121 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0121 | 1 | 1 |
| Echinococcus granulosus | protein piccolo | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | variant SH3 domain-containing protein | 0.0121 | 1 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0121 | 1 | 1 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0121 | 1 | 1 |
| Brugia malayi | flavodoxin family protein | 0.0032 | 0.1225 | 0.1225 |
| Echinococcus multilocularis | UNCoordinated family member (unc 13) | 0.0121 | 1 | 1 |
| Echinococcus multilocularis | NADPH cytochrome P450 reductase | 0.0032 | 0.1225 | 0.1225 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0121 | 1 | 1 |
| Brugia malayi | NEDD4.2 | 0.0121 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0121 | 1 | 1 |
| Echinococcus granulosus | neural cell expressed developmentally | 0.0121 | 1 | 1 |
Activities
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 10158280
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.