Detailed information for compound 870038
Basic information
Technical information
- TDR Targets ID: 870038
- Name: N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-4 -nitrobenzamide
- MW: 372.377 | Formula: C21H16N4O3
-
H donors: 2
H acceptors: 4
LogP: 4
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1ccc(cc1NC(=O)c1ccc(cc1)[N+](=O)[O-])c1nc2c([nH]1)cccc2
- InChi: 1S/C21H16N4O3/c1-13-6-7-15(20-22-17-4-2-3-5-18(17)23-20)12-19(13)24-21(26)14-8-10-16(11-9-14)25(27)28/h2-12H,1H3,(H,22,23)(H,24,26)
- InChiKey: DZHGSASWYUBVBF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[5-(1H-benzimidazol-2-yl)-2-methyl-phenyl]-4-nitro-benzamide
- ZINC00828032
- AK-778/37026076
- A2187/0091977
- BAS 00734398
- N-[5-(1H-Benzoimidazol-2-yl)-2-methyl-phenyl]-4-nitro-benzamide
- Oprea1_589798
- Oprea1_750282
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | phosphoinositide-specific phospholipase C, putative | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | extended synaptotagmin 2 | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | extended synaptotagmin 2 | 0.0109 | 0.4866 | 0.4866 |
| Brugia malayi | WW domain containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | synaptotagmin 2 | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0109 | 0.4866 | 0.4866 |
| Toxoplasma gondii | Sma protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | UNCoordinated family member (unc 13) | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | copine, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | copine 9 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0083 | 0.3024 | 0.3024 |
| Schistosoma mansoni | rho gtpase activating protein | 0.0109 | 0.4866 | 0.4866 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | copine, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | copine, putative | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Trypanosoma brucei | C2 domain/Ankyrin repeats (3 copies), putative | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | otoferlin | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | phospholipase C homolog | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | synaptotagmin 15 | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | phosphatidylinositol 3-kinase catalytic subunit gamma | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | 0.0109 | 0.4866 | 0.4866 | |
| Brugia malayi | NEDD4.2 | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | calcium-dependent lipid-binding protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | vab10 spectraplakin, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | unc 13 (munc13) | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | synaptotagmin 1, 3, C.elegans, putative | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | E3 ubiquitin-protein ligase nedd-4 | 0.0109 | 0.4866 | 0.4866 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | splicing factor 3A subunit, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | copine family protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0109 | 0.4866 | 0.4866 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | protein kinase c epsilon type | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0109 | 0.4866 | 0.4866 |
| Toxoplasma gondii | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Brugia malayi | Variant SH3 domain containing protein | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | protein kinase, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | synaptotagmin protein 4 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | synaptotagmin protein 4 | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | Mername-AA248 (C02 family) | 0.0109 | 0.4866 | 0.4866 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | glut4 vesicle protein-related | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | Coiled-coil and C2 domain-containing protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | rab3 interacting molecule (rim)-related | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Toxoplasma gondii | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Plasmodium vivax | double C2-like domain-containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | protein piccolo | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | c2 domain protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | calpain 5 | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | phospholipase c-like protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | jmjC domain containing protein | 0.0104 | 0.4487 | 0.9221 |
| Onchocerca volvulus | Putative cc2d1b protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | calpain 5 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | Proline-rich protein, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Protein kinase c protein 2 | 0.0109 | 0.4866 | 1 |
| Brugia malayi | Synaptotagmin I | 0.0109 | 0.4866 | 1 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | AGC/PKC/ALPHA protein kinase | 0.0109 | 0.4866 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | synaptic ras gtpase activating protein syngap | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | copine 9 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | copine | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | multiple C2 and transmembrane domain containing protein | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | jumonji domain containing protein | 0.0044 | 0.0394 | 0.0394 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | DENN domain protein | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Loa Loa (eye worm) | Nedd4-PD | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | protein kinase C | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | copine 9 | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | myoferlin | 0.0109 | 0.4866 | 0.4866 |
| Plasmodium vivax | ferlin, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | synaptotagmin-1 | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | geminin | 0.0184 | 1 | 1 |
| Toxoplasma gondii | phosphoinositide phospholipase PIPLC | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | ankyrin repeat-containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | calcium-binding protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma brucei | Coiled-coil and C2 domain-containing protein | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | copine i-like protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | intersectin 2 | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | copine, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.1095 | 0.2251 |
| Echinococcus multilocularis | active breakpoint cluster region | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | mctp-related | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma brucei | predicted C2 domain protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | Circumsporozoite protein precursor, putative | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | C2 domain protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Synaptotagmin protein 3 | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | protein kinase C gamma type | 0.0109 | 0.4866 | 0.4866 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0109 | 0.4866 | 0.4866 |
| Onchocerca volvulus | Multiple C2 domain and transmembrane region protein homolog | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | C2 calcium lipid binding region, CaLB | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | copine 9 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | synaptotagmin 2 | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | phosphatidylinositol-45-bisphosphate 3-kinase catalytic subunit alpha PI3K | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | phospholipase C-like protein 2 plc-L2 | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0109 | 0.4866 | 0.4866 |
| Toxoplasma gondii | ferlin family protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | fer-1-related | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Brugia malayi | calpain 5 | 0.0109 | 0.4866 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | rabphilin-3a | 0.0109 | 0.4866 | 0.4866 |
| Leishmania major | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | jumonji domain containing protein | 0.0044 | 0.0394 | 0.0394 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | intersectin 2 | 0.0109 | 0.4866 | 0.4866 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Loa Loa (eye worm) | AGC/PKC/ETA protein kinase | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | myoferlin | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | multiple C2 and transmembrane domain containing protein | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | nedd-4-like E3 ubiquitin-protein ligase | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma cruzi | cAMP binding protein, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Copine family protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Leishmania major | c2 domain protein, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | synaptotagmin | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | synaptotagmin 12 | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trypanosoma cruzi | C2 domain containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | Immunoglobulin E set | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | Protein kinase C brain isozyme | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | ion channel nompc, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Phosphatidylinositol 3- and 4-kinase family protein | 0.0109 | 0.4866 | 1 |
| Loa Loa (eye worm) | C2 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | regulator of G protein signaling 3 rgs3 | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Synapse defective protein 1 | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0104 | 0.4487 | 0.4487 |
| Onchocerca volvulus | 0.0109 | 0.4866 | 0.5 | |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Plasmodium falciparum | ferlin, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | neural cell expressed, developmentally | 0.0109 | 0.4866 | 0.4866 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | LD23056p | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | protein piccolo | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase beta-4 | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | phosphatidylinositol-specific phospholipase C | 0.0109 | 0.4866 | 1 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | synaptotagmin-like protein | 0.0109 | 0.4866 | 0.4866 |
| Toxoplasma gondii | hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | protein kinase C II. | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Echinococcus granulosus | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0109 | 0.4866 | 0.4866 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma brucei | phosphoinositide-specific phospholipase C | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0104 | 0.4487 | 0.4487 |
| Schistosoma mansoni | unc-13 (munc13) | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | synaptotagmin 15 | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | UNCoordinated family member unc 13 | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | active breakpoint cluster region | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus granulosus | C2 calcium lipid binding region CaLB | 0.0109 | 0.4866 | 0.4866 |
| Trypanosoma brucei | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0066 | 0.1857 | 0.3815 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | protein kinase c epsilon type | 0.0109 | 0.4866 | 0.4866 |
| Plasmodium falciparum | ferlin, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Synapse defective protein 1 | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | protein kinase, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Toxoplasma gondii | C2 domain-containing protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin 1,2, putative | 0.0109 | 0.4866 | 0.5 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | neural cell expressed developmentally | 0.0109 | 0.4866 | 0.4866 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0109 | 0.4866 | 0.4866 |
| Echinococcus multilocularis | NEDD4 E3 ubiquitin protein ligase WWP1 | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trypanosoma brucei | cAMP binding protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | synaptotagmin, putative | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | Copine VIII | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0184 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Trichomonas vaginalis | copine, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | unc 13 munc13 | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Plasmodium falciparum | double C2-like domain-containing protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus granulosus | otoferlin | 0.0109 | 0.4866 | 0.4866 |
| Brugia malayi | Phosphatidylinositol-specific phospholipase C, X domain containing protein | 0.0109 | 0.4866 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0184 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | C2 calcium dependent membrane targeting | 0.0109 | 0.4866 | 0.4866 |
| Plasmodium vivax | ferlin, putative | 0.0109 | 0.4866 | 0.5 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | C2 domain/Ankyrin repeats (3 copies), putative | 0.0109 | 0.4866 | 0.5 |
| Schistosoma mansoni | hypothetical protein | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | variant SH3 domain-containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | serine threonine protein kinase | 0.0109 | 0.4866 | 0.4866 |
| Loa Loa (eye worm) | hypothetical protein | 0.0109 | 0.4866 | 1 |
| Entamoeba histolytica | Rap/Ran GTPase activating protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | annexin VII, putative | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Brugia malayi | C2 domain containing protein | 0.0109 | 0.4866 | 1 |
| Echinococcus multilocularis | Protein kinase C, brain isozyme | 0.0109 | 0.4866 | 0.4866 |
| Entamoeba histolytica | C2 domain containing protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma brucei | C2 domain containing protein, putative | 0.0109 | 0.4866 | 0.5 |
| Trypanosoma cruzi | cytoskeleton associated protein, putative | 0.0109 | 0.4866 | 0.5 |
| Toxoplasma gondii | Elicitor-responsive protein, putative | 0.0109 | 0.4866 | 0.5 |
| Echinococcus multilocularis | 1 phosphatidylinositol 4,5 bisphosphate | 0.0109 | 0.4866 | 0.4866 |
Activities
No activities found for this compound.
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.