Detailed information for compound 951974
Basic information
Technical information
- Name: Unnamed compound
- MW: 800.825 | Formula: C41H43F3N8O6
-
H donors: 6
H acceptors: 8
LogP: 5.67
Rotable bonds: 21
Rule of 5 violations (Lipinski): 3 - SMILES: OC(=O)C(F)(F)F.N/C(=N/C(=O)CCCn1nnc(c1)c1ccccc1)/NCCC[C@H](C(=O)NCc1ccc(cc1)O)NC(=O)C(c1ccccc1)c1ccccc1
- InChi: 1S/C39H42N8O4.C2HF3O2/c40-39(44-35(49)19-11-25-47-27-34(45-46-47)29-12-4-1-5-13-29)41-24-10-18-33(37(50)42-26-28-20-22-32(48)23-21-28)43-38(51)36(30-14-6-2-7-15-30)31-16-8-3-9-17-31;3-2(4,5)1(6)7/h1-9,12-17,20-23,27,33,36,48H,10-11,18-19,24-26H2,(H,42,50)(H,43,51)(H3,40,41,44,49);(H,6,7)/t33-;/m1./s1
- InChiKey: RENMJQLPRIEKCC-MGDILKBHSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | neuropeptide Y receptor Y1 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Brugia malayi | follicle stimulating hormone receptor | neuropeptide Y receptor Y1 | 384 aa | 345 aa | 22.0 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | hypothetical protein | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Leishmania major | short chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Brugia malayi | D-beta-hydroxybutyrate dehydrogenase, mitochondrial precursor | 0.0035 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 2 | 0.0035 | 1 | 1 |
| Mycobacterium leprae | PROBABLE SHORT CHAIN ALCOHOL DEHYDROGENASE/REDUCTASE | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | estradiol 17 beta dehydrogenase 12 | 0.0035 | 1 | 0.5 |
| Echinococcus granulosus | epidermal retinal dehydrogenase 2 | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | Short-chain alcohol dehydrogenase family enzyme | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-ketoacyl-ACP reductase | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Possible iron-regulated short-chain dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | dehydrogenase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | 3 ketodihydrosphingosine reductase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 13 | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | hydroxyacyl dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Mycobacterium tuberculosis | Possible ketoacyl reductase | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | 3-keto-dihydrosphingosine reductase | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type oxidoreductase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trypanosoma brucei | oxidoreductase-like protein | 0.0035 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trypanosoma brucei | 3-ketoacyl-CoA reductase, putative | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short-chain dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | 2,4-dienoyl CoA reductase 2, peroxisomal family protein | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Echinococcus multilocularis | transient receptor potential cation channel | 0.0035 | 1 | 0.5 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | oxidoreductase | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Possible oxidoreductase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Echinococcus granulosus | oxidoreductase | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | dehydrogenase/decarboxylase protein | 0.0035 | 1 | 1 |
| Brugia malayi | Hypothetical oxidoreductase F56D1.5 | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Plasmodium falciparum | steroid dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium leprae | ROBABLE SHORT-CHAIN TYPE DEHYDROGENASE/REDUCTASE | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | beta-D-hydroxybutyrate dehydrogenase | 0.0035 | 1 | 1 |
| Brugia malayi | Dehydrogenases, short chain protein 30 | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Decaprenylphosphoryl-D-2-keto erythro pentose reductase | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | Dehydrogenase:reductase SDR family | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | carveol-like dehydrogenase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Trichomonas vaginalis | steroid dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Plasmodium falciparum | conserved Plasmodium protein, unknown function | 0.0035 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 1 homolog | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | cytochrome P450 family protein | 0.0029 | 0.6534 | 0.6534 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0035 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | retinal dehydrogenase | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Giardia lamblia | Reductase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium leprae | Possible short-chain dehydrogenase EphD | 0.0035 | 1 | 0.5 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Brugia malayi | Retinol dehydrogenase 12 | 0.0035 | 1 | 1 |
| Echinococcus granulosus | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0035 | 1 | 0.5 |
| Giardia lamblia | Short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Leishmania major | oxidoreductase-like protein | 0.0035 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Leishmania major | dehydrogenase-like protein | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0035 | 1 | 0.5 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | 3-ketoacyl-CoA reductase, putative | 0.0035 | 1 | 1 |
| Echinococcus granulosus | 3 ketodihydrosphingosine reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Brugia malayi | dehydrogenases, short chain protein 2 | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Mycobacterium leprae | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible short-chain dehydrogenase EphD | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 0.5 |
| Plasmodium vivax | steroid dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Giardia lamblia | Oxidoreductase, short chain dehydrogenase/reductase family | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | estradiol 17-beta-dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0035 | 1 | 1 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Possible multi-functional enzyme with acyl-CoA-reductase activity AcrA1 | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenases/reductase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable shortchain dehydrogenase | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | oxidoreductase, short chain dehydrogenase/reductase family | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | 3-ketodihydrosphingosine reductase protein, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0035 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Plasmodium falciparum | oxidoreductase, short-chain dehydrogenase family, putative | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Leishmania major | short chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | oxidoreductase short chain dehydrogenase/reductase family | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Brugia malayi | Cytochrome P450 family protein | 0.0029 | 0.6534 | 0.6534 |
| Echinococcus multilocularis | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Leishmania major | short chain dehydrogenase/reductase, putative | 0.0035 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | hypothetical protein, conserved | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Trichomonas vaginalis | short-chain dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | epidermal retinal dehydrogenase 2 | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | 3-alpha-hydroxysteroid dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Toxoplasma gondii | carbonyl reductase 1, putative | 0.0035 | 1 | 0.5 |
| Entamoeba histolytica | short chain dehydrogenase family protein | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Mycobacterium leprae | Probable oxidoreductase | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | Dehydrogenase\/reductase SDR family member 13 homolog | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | ketoacyl reductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | oxidoreductase | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain membrane-associated dehydrogenase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | steroid dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable short chain alcohol dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 1 | 1 |
| Echinococcus multilocularis | retinol dehydrogenase 11 | 0.0035 | 1 | 0.5 |
| Echinococcus granulosus | hypothetical protein | 0.0035 | 1 | 0.5 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Leishmania major | pteridine reductase 1 | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | short chain dehydrogenase/reductase, putative | 0.0035 | 1 | 1 |
| Echinococcus granulosus | WW domain containing oxidoreductase | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Probable dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Schistosoma mansoni | carbonyl reductase | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | NAD(P)-dependent oxidoreductase, putative | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | oxidoreductase | 0.0035 | 1 | 1 |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 3, putative | 0.0035 | 1 | 1 |
| Onchocerca volvulus | Sepiapterin reductase homolog | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | sterol carrier protein-2 HAD-2SCP-2 | 0.0035 | 1 | 0.5 |
| Echinococcus granulosus | retinol dehydrogenase 11 | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 0.5 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Echinococcus granulosus | Dehydrogenase:reductase SDR family | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | 3-keto-dihydrosphingosine reductase | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | quinonoid dihydropteridine reductase, putative | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | conserved hypothetical protein | 0.0035 | 1 | 0.5 |
| Trypanosoma brucei | short-chain dehydrogenase, putative | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | dehydrogenase | 0.0035 | 1 | 1 |
| Toxoplasma gondii | 3-ketoacyl-CoA reductase, putative | 0.0035 | 1 | 0.5 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0035 | 1 | 0.5 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | 3-keto-dihydrosphingosine reductase | 0.0035 | 1 | 1 |
| Loa Loa (eye worm) | short chain dehydrogenase/reductase family oxidoreductase | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Mycobacterium ulcerans | short-chain dehydrogenase | 0.0035 | 1 | 1 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
| Echinococcus granulosus | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Brugia malayi | dehydrogenases, short chain protein 9 | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | beta-ketoacyl-ACP reductase 2, putative | 0.0035 | 1 | 1 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Mycobacterium tuberculosis | Possible fatty acyl-CoA reductase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short-chain type oxidoreductase | 0.0035 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 0.5 |
| Echinococcus multilocularis | carbonyl reductase 1 | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | oxidoreductase-like protein, putative | 0.0035 | 1 | 1 |
| Onchocerca volvulus | 0.0035 | 1 | 0.5 | |
| Trypanosoma brucei | beta-ketoacyl-ACP reductase 2 | 0.0035 | 1 | 1 |
| Leishmania major | short chain dehydrogenase-like protein | 0.0035 | 1 | 1 |
| Toxoplasma gondii | oxidoreductase, putative | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 1 | 1 |
| Leishmania major | quinonoid dihydropteridine reductase | 0.0035 | 1 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0035 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0035 | 1 | 1 |
| Trichomonas vaginalis | estradiol 17 beta-dehydrogenase, putative | 0.0035 | 1 | 0.5 |
| Leishmania major | 3-keto-dihydrosphingosine reductase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | short chain dehydrogenase | 0.0035 | 1 | 0.5 |
| Mycobacterium ulcerans | short chain dehydrogenase | 0.0035 | 1 | 1 |
| Schistosoma mansoni | carbonyl reductase | 0.0035 | 1 | 0.5 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0035 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Kb (functional) | = 0.9 nM | Antagonist activity at NPY Y1 receptor in HEL cells assessed as inhibition of NPY-induced increase in intracellular calcium mobilization by Fura-2 assay | ChEMBL. | 18851917 |
| Ki (binding) | = 49 nM | Displacement of NG-([2,3-3H]propionyl)-BIBP-3226 from NPY Y1 receptor in human SK-N-MC cells | ChEMBL. | 18851917 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL451670
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.