TDR Targets

Basic information

Technical information

Name: Unnamed compound
MW: 413.475 | Formula: C23H23N7O
H donors: 2 H acceptors: 5 LogP: 3.71 Rotable bonds: 8
Rule of 5 violations (Lipinski): 1
SMILES: Cc1ccc(cc1)Nc1nc(NCCc2ccncc2)ncc1c1nnc(o1)C1CC1
InChi: 1S/C23H23N7O/c1-15-2-6-18(7-3-15)27-20-19(22-30-29-21(31-22)17-4-5-17)14-26-23(28-20)25-13-10-16-8-11-24-12-9-16/h2-3,6-9,11-12,14,17H,4-5,10,13H2,1H3,(H2,25,26,27,28)
InChiKey: VIVVUXJMHUNAFB-UHFFFAOYSA-N

Network

Hover on a compound node to display the structore

Target Layer

Model Organisms

Species	Viewmode
Arabidopsis thaliana
Caenorhabditis elegans
Dictyostelium discoideum
Drosophila melanogaster
Escherichia coli
Homo sapiens
Mus musculus
Oryza sativa
Saccharomyces cerevisiae
Schmidtea mediterranea
Other organisms

TDR Pathogens:

Species	Viewmode
Brugia malayi
Chlamydia trachomatis
Echinococcus granulosus
Entamoeba histolytica
Echinococcus multilocularis
Giardia lamblia
Leishmania major
Loa Loa (eye worm)
Mycobacterium leprae
Mycobacterium tuberculosis
Mycobacterium ulcerans
Onchocerca volvulus
Plasmodium falciparum
Plasmodium vivax
Schistosoma mansoni
Trypanosoma brucei
Trypanosoma cruzi
Toxoplasma gondii
Treponema pallidum
Trichomonas vaginalis
Wolbachia endosymbiont of Brugia malayi

Other Pathogens:

Species	Viewmode
Babesia bovis
Candida albicans
Cryptosporidium hominis
Cryptosporidium parvum
Leishmania braziliensis
Leishmania donovani
Leishmania infantum
Leishmania mexicana
Neospora caninum
Plasmodium berghei
Plasmodium knowlesi
Plasmodium yoelii
Schistosoma japonicum
Trypanosoma brucei gambiense
Trypanosoma congolense
Theileria parva

Compound Layer

This is a work in progress. Come back soon to try this features!

Clustering layers

This is a work in progress. Come back soon to try this features!

Synonyms

No synonyms found for this compound

Targets

Known targets for this compound

Species	Target name	Source	Bibliographic reference
Homo sapiens	fms-related tyrosine kinase 3	Starlite/ChEMBL	References

Predicted pathogen targets for this compound

By orthology

No druggable targets predicted by orthology data

By sequence similarity to non orthologous known druggable targets

No druggable targets predicted by sequence similarity

Ranking Plot

Putative Targets List

Species	Potential target	Raw	Global	Species
Echinococcus granulosus	C2 calcium lipid binding region CaLB	0.0107	0.5	0.5
Echinococcus granulosus	copine 9	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Plasmodium falciparum	double C2-like domain-containing protein	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Trichomonas vaginalis	ion channel nompc, putative	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Entamoeba histolytica	protein kinase, putative	0.0107	0.5	0.5
Schistosoma mansoni	synaptic ras gtpase activating protein syngap	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Brugia malayi	calpain 5	0.0107	0.5	0.5
Entamoeba histolytica	DENN domain protein	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Echinococcus granulosus	protein kinase c epsilon type	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin	0.0107	0.5	0.5
Loa Loa (eye worm)	variant SH3 domain-containing protein	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Brugia malayi	Protein kinase c protein 2	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Brugia malayi	Synaptotagmin I	0.0107	0.5	0.5
Trypanosoma cruzi	cytoskeleton associated protein, putative	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Schistosoma mansoni	otoferlin	0.0107	0.5	0.5
Brugia malayi	Copine family protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0107	0.5	0.5
Echinococcus granulosus	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Plasmodium falciparum	ferlin, putative	0.0107	0.5	0.5
Schistosoma mansoni	rho gtpase activating protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	vab10 spectraplakin, putative	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin 1, 3, C.elegans, putative	0.0107	0.5	0.5
Trypanosoma brucei	predicted C2 domain protein	0.0107	0.5	0.5
Echinococcus granulosus	myoferlin	0.0107	0.5	0.5
Trichomonas vaginalis	copine, putative	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Toxoplasma gondii	phosphoinositide phospholipase PIPLC	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	UNCoordinated family member (unc 13)	0.0107	0.5	0.5
Echinococcus granulosus	1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase beta-4	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus granulosus	Immunoglobulin E set	0.0107	0.5	0.5
Echinococcus granulosus	protein piccolo	0.0107	0.5	0.5
Echinococcus multilocularis	active breakpoint cluster region	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Trichomonas vaginalis	copine, putative	0.0107	0.5	0.5
Trichomonas vaginalis	copine, putative	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Loa Loa (eye worm)	Nedd4-PD	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	phosphatidylinositol-specific phospholipase C	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus granulosus	intersectin 2	0.0107	0.5	0.5
Trypanosoma brucei	predicted C2 domain protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Entamoeba histolytica	Rap/Ran GTPase activating protein, putative	0.0107	0.5	0.5
Trichomonas vaginalis	copine, putative	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Brugia malayi	Synapse defective protein 1	0.0107	0.5	0.5
Plasmodium falciparum	ferlin, putative	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Echinococcus multilocularis	myoferlin	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Trichomonas vaginalis	annexin VII, putative	0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	serine threonine protein kinase	0.0107	0.5	0.5
Brugia malayi	Variant SH3 domain containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trypanosoma brucei	cAMP binding protein, putative	0.0107	0.5	0.5
Plasmodium vivax	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus granulosus	unc 13 munc13	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Trypanosoma cruzi	Coiled-coil and C2 domain-containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Schistosoma mansoni	nedd-4-like E3 ubiquitin-protein ligase	0.0107	0.5	0.5
Echinococcus multilocularis	copine 9	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Brugia malayi	NEDD4.2	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Schistosoma mansoni	regulator of G protein signaling 3 rgs3	0.0107	0.5	0.5
Echinococcus multilocularis	1 phosphatidylinositol 4,5 bisphosphate	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Entamoeba histolytica	calcium-binding protein, putative	0.0107	0.5	0.5
Trypanosoma brucei	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus multilocularis	Protein kinase C, brain isozyme	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus granulosus	calpain 5	0.0107	0.5	0.5
Entamoeba histolytica	protein kinase, putative	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin 2	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein, conserved	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Schistosoma mansoni	mctp-related	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Echinococcus granulosus	otoferlin	0.0107	0.5	0.5
Toxoplasma gondii	hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	copine, putative	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Trypanosoma brucei	C2 domain/Ankyrin repeats (3 copies), putative	0.0107	0.5	0.5
Onchocerca volvulus	Putative cc2d1b protein	0.0107	0.5	0.5
Echinococcus granulosus	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin 15	0.0107	0.5	0.5
Schistosoma mansoni	protein kinase C	0.0107	0.5	0.5
Echinococcus multilocularis		0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Echinococcus granulosus	neural cell expressed developmentally	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain protein, putative	0.0107	0.5	0.5
Trypanosoma cruzi	synaptotagmin, putative	0.0107	0.5	0.5
Trypanosoma cruzi	C2 domain/Ankyrin repeats (3 copies), putative	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Trypanosoma brucei	C2 domain containing protein, putative	0.0107	0.5	0.5
Echinococcus granulosus	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Schistosoma mansoni	glut4 vesicle protein-related	0.0107	0.5	0.5
Toxoplasma gondii	hypothetical protein	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin 2	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trypanosoma brucei	C2 domain containing protein, putative	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Schistosoma mansoni	serine/threonine protein kinase	0.0107	0.5	0.5
Loa Loa (eye worm)	phosphatidylinositol 3-kinase catalytic subunit gamma	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein, conserved	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Trypanosoma brucei	phosphoinositide-specific phospholipase C	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Toxoplasma gondii	ferlin family protein	0.0107	0.5	0.5
Toxoplasma gondii	Sma protein	0.0107	0.5	0.5
Toxoplasma gondii	C2 domain-containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	AGC/PKC/ETA protein kinase	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin	0.0107	0.5	0.5
Brugia malayi	WW domain containing protein	0.0107	0.5	0.5
Trypanosoma cruzi	hypothetical protein, conserved	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Schistosoma mansoni	unc-13 (munc13)	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin	0.0107	0.5	0.5
Schistosoma mansoni	copine	0.0107	0.5	0.5
Brugia malayi	LD23056p	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Echinococcus granulosus	protein kinase C gamma type	0.0107	0.5	0.5
Echinococcus granulosus	extended synaptotagmin 2	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Leishmania major	c2 domain protein, putative	0.0107	0.5	0.5
Loa Loa (eye worm)	synaptotagmin-1	0.0107	0.5	0.5
Schistosoma mansoni	fer-1-related	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin 15	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Schistosoma mansoni	subfamily C1A unassigned peptidase (C01 family)	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin	0.0107	0.5	0.5
Trypanosoma brucei	hypothetical protein, conserved	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin-like protein	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin 12	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Brugia malayi	Phosphatidylinositol 3- and 4-kinase family protein	0.0107	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0107	0.5	0.5
Brugia malayi	phospholipase C homolog	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	protein kinase c epsilon type	0.0107	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	calcium-dependent lipid-binding protein, putative	0.0107	0.5	0.5
Trypanosoma cruzi	phosphoinositide-specific phospholipase C, putative	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin 1, 3, C.elegans, putative	0.0107	0.5	0.5
Schistosoma mansoni	serine/threonine protein kinase	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Schistosoma mansoni	rabphilin-3a	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Brugia malayi	Synaptotagmin protein 3	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Schistosoma mansoni	unc-13 (munc13)	0.0107	0.5	0.5
Echinococcus granulosus	UNCoordinated family member unc 13	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium lipid binding region, CaLB	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Leishmania major	phospholipase c-like protein	0.0107	0.5	0.5
Trypanosoma brucei	C2 domain containing protein, putative	0.0107	0.5	0.5
Echinococcus granulosus	C2 calcium lipid binding region CaLB	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin	0.0107	0.5	0.5
Schistosoma mansoni	serine/threonine protein kinase	0.0107	0.5	0.5
Echinococcus multilocularis	unc 13 (munc13)	0.0107	0.5	0.5
Trypanosoma brucei	C2 domain containing protein, putative	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Trypanosoma cruzi	cytoskeleton associated protein, putative	0.0107	0.5	0.5
Echinococcus multilocularis	NEDD4 E3 ubiquitin protein ligase WWP1	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Echinococcus granulosus	multiple C2 and transmembrane domain containing protein	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin	0.0107	0.5	0.5
Trichomonas vaginalis	Proline-rich protein, putative	0.0107	0.5	0.5
Trichomonas vaginalis	ankyrin repeat-containing protein, putative	0.0107	0.5	0.5
Echinococcus multilocularis	extended synaptotagmin 2	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Brugia malayi	protein kinase C II.	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Brugia malayi	Copine VIII	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin 12	0.0107	0.5	0.5
Toxoplasma gondii	hypothetical protein	0.0107	0.5	0.5
Trypanosoma brucei	Coiled-coil and C2 domain-containing protein	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Plasmodium vivax	ferlin, putative	0.0107	0.5	0.5
Echinococcus granulosus	C2 calcium dependent membrane targeting	0.0107	0.5	0.5
Trypanosoma brucei	synaptotagmin, putative	0.0107	0.5	0.5
Schistosoma mansoni	phospholipase C-like protein 2 plc-L2	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Trypanosoma cruzi	cAMP binding protein, putative	0.0107	0.5	0.5
Echinococcus multilocularis	C2 calcium lipid binding region, CaLB	0.0107	0.5	0.5
Leishmania major	c2 domain protein, putative	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Toxoplasma gondii	Elicitor-responsive protein, putative	0.0107	0.5	0.5
Trypanosoma brucei	predicted C2 domain protein	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin	0.0107	0.5	0.5
Echinococcus granulosus	synaptotagmin protein 4	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Echinococcus multilocularis	neural cell expressed, developmentally	0.0107	0.5	0.5
Echinococcus granulosus	multiple C2 and transmembrane domain containing protein	0.0107	0.5	0.5
Onchocerca volvulus	Multiple C2 domain and transmembrane region protein homolog	0.0107	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	intersectin 2	0.0107	0.5	0.5
Schistosoma mansoni	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	calpain 5	0.0107	0.5	0.5
Echinococcus granulosus	Protein kinase C brain isozyme	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Plasmodium falciparum	conserved Plasmodium protein, unknown function	0.0107	0.5	0.5
Trypanosoma cruzi	synaptotagmin, putative	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	copine 9	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin 1,2, putative	0.0107	0.5	0.5
Schistosoma mansoni	unc-13 (munc13)	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin 1,2, putative	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Loa Loa (eye worm)	C2 domain-containing protein	0.0107	0.5	0.5
Leishmania major	copine i-like protein	0.0107	0.5	0.5
Plasmodium vivax	double C2-like domain-containing protein, putative	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Schistosoma mansoni	synaptotagmin	0.0107	0.5	0.5
Leishmania major	hypothetical protein, conserved	0.0107	0.5	0.5
Schistosoma mansoni	E3 ubiquitin-protein ligase nedd-4	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	synaptotagmin protein 4	0.0107	0.5	0.5
Plasmodium vivax	ferlin, putative	0.0107	0.5	0.5
Trichomonas vaginalis	splicing factor 3A subunit, putative	0.0107	0.5	0.5
Echinococcus granulosus	copine 9	0.0107	0.5	0.5
Brugia malayi	C2 domain containing protein	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Entamoeba histolytica	hypothetical protein	0.0107	0.5	0.5
Echinococcus multilocularis	multiple C2 and transmembrane domain containing protein	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Brugia malayi	Synapse defective protein 1	0.0107	0.5	0.5
Loa Loa (eye worm)	copine family protein	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin 1,2, putative	0.0107	0.5	0.5
Trichomonas vaginalis	Circumsporozoite protein precursor, putative	0.0107	0.5	0.5
Echinococcus multilocularis	multiple C2 and transmembrane domain containing protein	0.0107	0.5	0.5
Echinococcus multilocularis	protein piccolo	0.0107	0.5	0.5
Brugia malayi	Phosphatidylinositol-specific phospholipase C, X domain containing protein	0.0107	0.5	0.5
Loa Loa (eye worm)	AGC/PKC/ALPHA protein kinase	0.0107	0.5	0.5
Onchocerca volvulus		0.0107	0.5	0.5
Echinococcus granulosus	NEDD4 E3 ubiquitin protein ligase WWP1	0.0107	0.5	0.5
Trichomonas vaginalis	conserved hypothetical protein	0.0107	0.5	0.5
Loa Loa (eye worm)	hypothetical protein	0.0107	0.5	0.5
Schistosoma mansoni	phosphatidylinositol-45-bisphosphate 3-kinase catalytic subunit alpha PI3K	0.0107	0.5	0.5
Trypanosoma cruzi	C2 domain containing protein, putative	0.0107	0.5	0.5
Schistosoma mansoni	rab3 interacting molecule (rim)-related	0.0107	0.5	0.5
Trichomonas vaginalis	synaptotagmin, putative	0.0107	0.5	0.5
Echinococcus granulosus	active breakpoint cluster region	0.0107	0.5	0.5
Entamoeba histolytica	C2 domain containing protein	0.0107	0.5	0.5
Schistosoma mansoni	Mername-AA248 (C02 family)	0.0107	0.5	0.5

Activities

Activity type	Activity value	Assay description	Source	Reference
GI50 (functional)	= 23 nmol/L	Antiproliferative activity against human MOLM13 cells after 72 hrs by WST-1 assay	ChEMBL.	18835166
IC50 (binding)	= 106 nmol/L	Inhibition of GST-tagged FLT3 by ELISA	ChEMBL.	18835166

Phenotypes

Whole-cell/tissue/organism interactions

We have no records of whole-cell/tissue assays done with this compound What does this mean?

Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.

Annotated phenotypes:

We have no manually annotated phenotypes for this drug. What does this mean? / Care to help?

In TDR Targets, information about phenotypes that are caused by drugs, or by genetic manipulation of cells (e.g. gene knockouts or knockdowns) is manually curated from the literature. These descriptions help to describe the potential of the target for drug development. If no information is available for this gene or if the information is incomplete, this may mean that i) the papers containing this information either appeared after the curation effort for this organism was carried out or they were inadvertently missed by curators; or that ii) the curation effort for this organism has not yet started.

In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.

External resources for this compound

ChEMBL: CHEMBL486948

Bibliographic References

1 literature reference was collected for this gene.

If you have references for this compound, please enter them in a user comment (below) or Contact us.

Detailed information for compound 988281